Lauryl acrylate
PubChem CID: 75084
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dodecyl acrylate, 2156-97-0, Lauryl acrylate, dodecyl prop-2-enoate, n-Lauryl acrylate, n-Dodecyl acrylate, 2-Propenoic acid, dodecyl ester, Acrylic acid, dodecyl ester, Acrylic Acid Lauryl Ester, dodecyl propenoate, Acrylic Acid Dodecyl Ester, 90IK36WGVR, Ageflex FA-12, EINECS 218-463-4, NSC 24177, NSC-24177, LIGHT ACRYLATE L-A, UNII-90IK36WGVR, PHOTOMER 4812, Dodecyl Acrylate (stabilized with MEHQ), N-Lauryl acrylate (monomer), 2-propenoic acid dodecyl ester, AI3-03198, DTXSID7022178, CHEBI:191951, 2-Propenoic acid, n-dodecyl ester, SR 335, EC 218-463-4, Acrylic acid-dodecyl ester, C15H28O2, MFCD00042871, SCHEMBL14939, LAURYL ACRYLATE [INCI], DTXCID702178, NSC24177, AKOS015916172, Lauryl acrylate, technical grade, 90%, LS-14452, D4129, NS00002331, F20309, Q27271326 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCCCCCCCCCCOC=O)C=C |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohol esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 187.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | dodecyl prop-2-enoate |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 6.2 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C15H28O2 |
| Inchi Key | PBOSTUDLECTMNL-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 13.0 |
| Synonyms | dodecyl acrylate |
| Esol Class | Moderately soluble |
| Functional Groups | C=CC(=O)OC |
| Compound Name | Lauryl acrylate |
| Exact Mass | 240.209 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 240.209 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 240.38 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H28O2/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2/h4H,2-3,5-14H2,1H3 |
| Smiles | CCCCCCCCCCCCOC(=O)C=C |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Cinnamomum Tamala (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2009.9700237 - 2. Outgoing r'ship
FOUND_INto/from Gynura Bicolor (Plant) Rel Props:Reference:ISBN:9770972795006