Leucodelphinidin 3-glucoside
PubChem CID: 74977207
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Diospyrin?, Leucodelphinidin 3-glucoside |
|---|---|
| Topological Polar Surface Area | 230.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Heavy Atom Count | 34.0 |
| Description | Isolated from Diospyros kaki (Japanese persimmon). Leucodelphinidin 3-glucoside is found in japanese persimmon and fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 671.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-4,5,7-triol |
| Nih Violation | True |
| Class | Flavonoids |
| Xlogp | -1.6 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | True |
| Subclass | Flavonoid glycosides |
| Molecular Formula | C21H24O13 |
| Inchi Key | XCZZWPJIGBONJX-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | Diospyrin?, Leucodelphinidin 3-glucoside |
| Compound Name | Leucodelphinidin 3-glucoside |
| Kingdom | Organic compounds |
| Exact Mass | 484.122 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 484.122 |
| Hydrogen Bond Acceptor Count | 13.0 |
| Molecular Weight | 484.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Inchi | InChI=1S/C21H24O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15-31H,5H2 |
| Smiles | C1=C(C=C(C(=C1O)O)O)C2C(C(C3=C(C=C(C=C3O2)O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Flavonoid-3-O-glycosides |
- 1. Outgoing r'ship
FOUND_INto/from Diospyros Kaki (Plant) Rel Props:Source_db:fooddb_chem_all