2-[2-[5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
PubChem CID: 74977109
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 259.0 |
|---|---|
| Hydrogen Bond Donor Count | 10.0 |
| Inchi Key | JEUXKMNBLUZESY-UHFFFAOYSA-O |
| Rotatable Bond Count | 9.0 |
| Synonyms | Malvidin 3-laminaribioside, Neflumozide HCL, Neflumozide hydrochloride, Neflumozide hydrochloride [usan] |
| Heavy Atom Count | 46.0 |
| Compound Name | 2-[2-[5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Kingdom | Organic compounds |
| Description | Isolated from Eugenia jambolana (jambolan). Malvidin 3-laminaribioside is found in java plum and fruits. |
| Exact Mass | 655.187 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 655.187 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 949.0 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 655.6 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[2-[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromenylium-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 10.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Class | Flavonoids |
| Inchi | InChI=1S/C29H34O17/c1-40-15-3-10(4-16(41-2)20(15)34)26-17(7-12-13(33)5-11(32)6-14(12)42-26)43-29-25(39)27(22(36)19(9-31)45-29)46-28-24(38)23(37)21(35)18(8-30)44-28/h3-7,18-19,21-25,27-31,35-39H,8-9H2,1-2H3,(H2-,32,33,34)/p+1 |
| Smiles | COC1=CC(=CC(=C1O)OC)C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)OC5C(C(C(C(O5)CO)O)O)O)O)O)O |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Flavonoid glycosides |
| Taxonomy Direct Parent | Anthocyanidin-3-O-glycosides |
| Molecular Formula | C29H35O17+ |
- 1. Outgoing r'ship
FOUND_INto/from Eugenia Jambolana (Plant) Rel Props:Source_db:fooddb_chem_all