Delphinidin 3-lathyroside 5-glucoside
PubChem CID: 74818467
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Delphinidin 3-lathyroside 5-glucoside, Delphinidin 5-glucoside 3-lathyroside |
|---|---|
| Topological Polar Surface Area | 340.0 |
| Hydrogen Bond Donor Count | 14.0 |
| Inchi Key | SVKUZBZQDMYGEP-UHFFFAOYSA-O |
| Rotatable Bond Count | 9.0 |
| Synonyms | Delphinidin 3-sambubioside-5-glucoside, Delphinidin 5-glucoside 3-sambubioside, Delphinidin 5-glucoside 3-lathyroside |
| Heavy Atom Count | 53.0 |
| Compound Name | Delphinidin 3-lathyroside 5-glucoside |
| Description | Isolated from peas and beans. Delphinidin 3-sambubioside 5-glucoside is found in pulses and common pea. |
| Exact Mass | 759.198 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 759.198 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1160.0 |
| Hydrogen Bond Acceptor Count | 20.0 |
| Molecular Weight | 759.6 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[3-[4,5-dihydroxy-6-(hydroxymethyl)-3-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-7-hydroxy-2-(3,4,5-trihydroxyphenyl)chromenylium-5-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 14.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C32H38O21/c33-6-18-22(41)24(43)27(46)31(51-18)49-16-4-10(35)3-15-11(16)5-17(28(48-15)9-1-12(36)20(39)13(37)2-9)50-32-29(25(44)23(42)19(7-34)52-32)53-30-26(45)21(40)14(38)8-47-30/h1-5,14,18-19,21-27,29-34,38,40-46H,6-8H2,(H3-,35,36,37,39)/p+1 |
| Smiles | C1C(C(C(C(O1)OC2C(C(C(OC2OC3=C([O+]=C4C=C(C=C(C4=C3)OC5C(C(C(C(O5)CO)O)O)O)O)C6=CC(=C(C(=C6)O)O)O)CO)O)O)O)O)O |
| Is Pains | True |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C32H39O21+ |
- 1. Outgoing r'ship
FOUND_INto/from Pisum Sativum (Plant) Rel Props:Source_db:fooddb_chem_all