gibberellin A120
PubChem CID: 74413650
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gibberellin A120, CHEBI:174282, 11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
|---|---|
| Topological Polar Surface Area | 63.6 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | WKDIZCSRKTURDM-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | Gibberellin A120 |
| Heavy Atom Count | 23.0 |
| Compound Name | gibberellin A120 |
| Description | Constituent of immature Prunus persica (peach) seeds. Gibberellin A120 is found in fruits and peach. |
| Exact Mass | 314.152 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 314.152 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 693.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 314.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| Total Atom Stereocenter Count | 7.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C19H22O4/c1-10-8-18-9-11(10)4-5-12(18)19-7-3-6-17(2,16(22)23-19)14(19)13(18)15(20)21/h3,7,11-14H,1,4-6,8-9H2,2H3,(H,20,21) |
| Smiles | CC12CC=CC3(C1C(C45C3CCC(C4)C(=C)C5)C(=O)O)OC2=O |
| Xlogp | 2.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C19H22O4 |
- 1. Outgoing r'ship
FOUND_INto/from Prunus Persica (Plant) Rel Props:Source_db:fooddb_chem_all