Glutaric acid
PubChem CID: 743
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | GLUTARIC ACID, Pentanedioic acid, 110-94-1, 1,5-Pentanedioic acid, glutarate, 1,3-Propanedicarboxylic acid, Pentandioic acid, n-Pyrotartaric acid, propane-1,3-dicarboxylic acid, Glutarsaeure, CHEBI:17859, HSDB 5542, NSC 9238, EINECS 203-817-2, MFCD00004410, UNII-H849F7N00B, BRN 1209725, DTXSID2021654, AI3-24247, H849F7N00B, NSC-9238, Abacavir related, DTXCID401654, NSC9238, 4-02-00-01934 (Beilstein Handbook Reference), 1,3-PENTANEDIOIC ACID (RIFM), CAS-110-94-1, ADIPIC ACID IMPURITY A (EP IMPURITY), ADIPIC ACID IMPURITY A [EP IMPURITY], Pentandioate, 1czc, 1,5-Pentanedioate, Glutaric acid, 99%, 4lh3, 1,3-Propanedicarboxylate, Glutaric acid (Standard), WLN: QV3VQ, bmse000406, GLUTARIC ACID [MI], SCHEMBL7414, GLUTARIC ACID [HSDB], Pentanedioic acid Glutaric acid, CHEMBL1162495, HY-W008820R, Tox21_202448, Tox21_302871, BDBM50485550, s3152, AKOS000118800, CS-W009536, DB03553, FG02567, HY-W008820, NCGC00249226-01, NCGC00256456-01, NCGC00259997-01, AS-13132, BP-21143, SY029948, G0069, G0245, NS00003673, EN300-17991, C00489, D70283, Q409622, Glutaric Acid (ca. 50% in Water, ca. 4.3mol/L), Z57127454, 78FA13BF-E0C0-4EFC-948C-534CF45044E3, F2191-0242, Glutaric acid, certified reference material, TraceCERT(R), InChI=1/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9, 203-817-2 |
|---|---|
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 9.0 |
| Description | Isolated from basidiomycete fungi and fruits of Prunus cerasus (CCD). Glutaric acid is found in many foods, some of which are red beetroot, common beet, soy bean, and tamarind. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 104.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q9NSA0, Q4U2R8, Q9Y694 |
| Iupac Name | pentanedioic acid |
| Nih Violation | False |
| Class | Carboxylic acids and derivatives |
| Xlogp | -0.3 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Dicarboxylic acids and derivatives |
| Molecular Formula | C5H8O4 |
| Inchi Key | JFCQEDHGNNZCLN-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | 1,3-Propanedicarboxylate, 1,3-Propanedicarboxylic acid, 1,5-Pentanedioate, 1,5-Pentanedioic acid, Glutarate, Glutaric acid, Glutarsaeure, Pentandioate, Pentandioic acid, Pentanedioate, Pentanedioic acid, Propane-1,3-dicarboxylic acid |
| Substituent Name | Fatty acid, Dicarboxylic acid or derivatives, Carboxylic acid, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic acyclic compound |
| Compound Name | Glutaric acid |
| Kingdom | Organic compounds |
| Exact Mass | 132.042 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 132.042 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 132.11 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9) |
| Smiles | C(CC(=O)O)CC(=O)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Dicarboxylic acids and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Beta Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Tamarindus Indica (Plant) Rel Props:Source_db:fooddb_chem_all