(2-Naphthyl)methanol
PubChem CID: 74128
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-NAPHTHALENEMETHANOL, 1592-38-7, naphthalen-2-ylmethanol, 2-Naphthylmethanol, 2-Hydroxymethylnaphthalene, (2-Naphthyl)methanol, 2-Naphthalene methanol, Naphthalen-2-yl-methanol, (naphthalen-2-yl)methanol, beta-Naphthylcarbinol, MFCD00004124, CHEBI:27615, NSC 408615, DTXSID70166607, 2-naphthylmethan-1-ol, 2-naphtylmethanol, Naphthalenemethanol, 2NA, (2-naphtyl)methanol, naphth-2-yl-methanol, 2-Naphthylmethanol #, naphthalen-2-yl methanol, bmse000683, 2-(hydroxymethyl)napthalene, 2-(Hydroxymethyl)naphthalene, SCHEMBL94384, 2-Naphthalenemethanol, 98%, CHEMBL150445, F3395-0160, DTXCID2089098, BCP27493, NSC408615, AKOS000249365, AC-5795, CS-W001953, FN14798, FS-3194, HY-W001953, NSC-408615, SY021110, (naphthalen-2-yl)methanol, 2-naphthylmethanol, N0881, C02909, EN300-1263458, Q27103227, 812-602-8 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CCCCC2C1 |
| Np Classifier Class | Phenanthrenes |
| Deep Smiles | OCcccccc6)cccc6 |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Naphthalenes |
| Scaffold Graph Node Level | C1CCC2CCCCC2C1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 144.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P11766, P17988 |
| Iupac Name | naphthalen-2-ylmethanol |
| Class | Naphthalenes |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 2.2 |
| Superclass | Benzenoids |
| Gsk 4 400 Rule | True |
| Molecular Formula | C11H10O |
| Scaffold Graph Node Bond Level | c1ccc2ccccc2c1 |
| Inchi Key | MFGWMAAZYZSWMY-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | 2-Hydroxymethylnaphthalene, 2-Naphthalenemethanol, Naphthalen-2-yl-methanol, 2-naphthalenemethanol |
| Esol Class | Soluble |
| Functional Groups | CO |
| Compound Name | (2-Naphthyl)methanol |
| Kingdom | Organic compounds |
| Exact Mass | 158.073 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 158.073 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 158.2 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C11H10O/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8H2 |
| Smiles | C1=CC=C2C=C(C=CC2=C1)CO |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Naphthalenes |
| Np Classifier Superclass | Phenanthrenoids |
- 1. Outgoing r'ship
FOUND_INto/from Pterocarpus Macrocarpus (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2016.1278183