25-Dehydrofungisterol
PubChem CID: 74051264
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 25-Dehydrofungisterol, CHEBI:175192, 17-(5,6-dimethylhept-6-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | ALAYAXMTAIVXMW-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | 25-Dehydrofungisterol |
| Heavy Atom Count | 29.0 |
| Compound Name | 25-Dehydrofungisterol |
| Kingdom | Organic compounds |
| Description | Isolated from seeds of Cucurbita maxima. 25-Dehydrofungisterol is found in many foods, some of which are cucumber, japanese pumpkin, fruits, and watermelon. |
| Exact Mass | 398.355 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 398.355 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 661.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 398.7 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 17-(5,6-dimethylhept-6-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Class | Steroids and steroid derivatives |
| Inchi | InChI=1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h10,19-22,24-26,29H,1,7-9,11-17H2,2-6H3 |
| Smiles | CC(CCC(C)C(=C)C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)O)C)C |
| Xlogp | 8.5 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Ergostane steroids |
| Taxonomy Direct Parent | Ergosterols and derivatives |
| Molecular Formula | C28H46O |
- 1. Outgoing r'ship
FOUND_INto/from Citrullus Lanatus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Cucumis Melo (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Cucumis Sativus (Plant) Rel Props:Source_db:fooddb_chem_all