Methyldiphenylphosphine
PubChem CID: 73879
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Methyldiphenylphosphine, 1486-28-8, PHOSPHINE, METHYLDIPHENYL-, Diphenylmethylphosphine, methyl(diphenyl)phosphane, Methyldiphenylphsphine, METHYLDIPHENYLPHOSPHANE, Diphenylphosphinomethane, RYN4FS3JEN, MFCD00008508, EINECS 216-065-5, NSC-158476, DTXSID30164028, NSC 158476, methyl(diphenyl)phosphine, C13H13P, Diphenyl-methylphosphine, methyldiphenylphoshine, NSC158476, methyldi-phenylphosphine, P-methyldiphenylphosphine, UNII-RYN4FS3JEN, methyl-di(phenyl)phosphane, SCHEMBL40441, Methyldiphenylphosphine, 99%, DTXCID4086519, SCHEMBL12244769, UJNZOIKQAUQOCN-UHFFFAOYSA-, AKOS015852460, CS-W015622, AS-58693, SY009856, DB-009768, M1318, NS00024868, F17170, EN300-8664028, 216-065-5, InChI=1/C13H13P/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(CC2CCCCC2)CC1 |
| Deep Smiles | CPcccccc6))))))cccccc6 |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | C1CCC(PC2CCCCC2)CC1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 137.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | methyl(diphenyl)phosphane |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C13H13P |
| Scaffold Graph Node Bond Level | c1ccc(Pc2ccccc2)cc1 |
| Inchi Key | UJNZOIKQAUQOCN-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | methyl-diphenylphosphine |
| Esol Class | Moderately soluble |
| Functional Groups | cP(c)C |
| Compound Name | Methyldiphenylphosphine |
| Exact Mass | 200.075 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 200.075 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 200.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C13H13P/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| Smiles | CP(C1=CC=CC=C1)C2=CC=CC=C2 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Jatropha Curcas (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.886965