Glycol Dimethacrylate
PubChem CID: 7355
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Ethylene glycol dimethacrylate, 97-90-5, Ethylene dimethacrylate, Glycol dimethacrylate, ETHYLENE METHACRYLATE, Diglycol dimethacrylate, Ethanediol dimethacrylate, Ethylenedimethyacrylate, Ethyldiol metacrylate, 1,2-Bis(methacryloyloxy)ethane, EGDMA, Sartomer SR 206, Ageflex EGDM, ethane-1,2-diyl bis(2-methylacrylate), Methacrylic acid, ethylene ester, Ethylene glycol bis(methacrylate), Ethyldiol methacrylate, Methacrylic acid ethylene ester, 1,2-Ethanediol dimethacrylate, SR 206, 2-Propenoic acid, 2-methyl-, 1,2-ethanediyl ester, CCRIS 179, NSC 24166, 1,2-Ethanediyl 2-methyl-2-propenoate, CHEBI:53436, HSDB 5313, EINECS 202-617-2, 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate, BRN 1776663, DTXSID1026615, UNII-7BK5G69305, NSC-24166, 7BK5G69305, 2-(Methacryloyloxy)ethyl 2-methylacrylate, DTXCID106615, EC 202-617-2, 2-methyl-2-propenoic acid 1,2-ethanediyl ester, NSC24166, 12738-39-5, 2-[(2-methylprop-2-enoyl)oxy]ethyl 2-methylprop-2-enoate, 2-Propenoic acid, 2-methyl-, 1,1'-(1,2-ethanediyl) ester, PORAPAK T (80-100 MESH ASTM) FOR GC, Ethylene Glycol Dimethacrylate (stabilized with HQ), ethyleneglycol dimethacrylate, CAS-97-90-5, Ethyleneglycoldimethacrylate (98%, contains 90-110 ppm monomethyletherhydroquinone as inhibitor), Ethylene glycol dimethacrylate,99%(egdma), Ageflex EGDMA, Perkalink 401, MFCD00008590, NK Ester 1G, PEG-DMA, Epitope ID:131323, TGM 1, SCHEMBL15636, 1,2-Bis(methacryloyoxy) ethane, CHEMBL1709582, CHEBI:53378, MFM-416, 1,2-bis-(methacryloyloxy)-ethane, ETHYLENE METHACRYLATE [HSDB], Tox21_201914, Tox21_303153, AKOS015837657, CS-W015656, HY-W014940, NCGC00163970-01, NCGC00163970-02, NCGC00163970-03, NCGC00257144-01, NCGC00259463-01, AS-78075, DA-73225, 2-(Methacryloyloxy)ethyl 2-methylacrylate #, E0102, NS00002804, D70270, F71209, Q2231462, 1,2-Ethanediol dimethacrylate Ethylene dimethacrylate, Ethylene Glycol Dimethacrylate, (stabilized with HQ), Polyethylene Glycol Dimethacrylate n≈4 (stabilized with MEHQ), 2-(dimethylamino)ethyl (2,5-dioxo-4,4-diphenyl-imidazolidin-1-yl)methyl carbonate, methanesulfonic acid, 202-617-2, Ethylene glycol dimethacrylate, 98%, contains 90-110 ppm monomethyl ether hydroquinone as inhibitor |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 52.6 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | O=CC=C)C))OCCOC=O)C=C)C |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Dicarboxylic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 237.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | Q92830, P10275, Q03181, P19838 |
| Iupac Name | 2-(2-methylprop-2-enoyloxy)ethyl 2-methylprop-2-enoate |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | 1.9 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H14O4 |
| Prediction Swissadme | 1.0 |
| Inchi Key | STVZJERGLQHEKB-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.4 |
| Logs | -2.003 |
| Rotatable Bond Count | 7.0 |
| Logd | 1.386 |
| Synonyms | ethylene methacrylate |
| Esol Class | Very soluble |
| Functional Groups | C=C(C)C(=O)OC |
| Compound Name | Glycol Dimethacrylate |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 198.089 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 198.089 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 198.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -1.9803516000000003 |
| Inchi | InChI=1S/C10H14O4/c1-7(2)9(11)13-5-6-14-10(12)8(3)4/h1,3,5-6H2,2,4H3 |
| Smiles | CC(=C)C(=O)OCCOC(=O)C(=C)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids, Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Bletilla Striata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Syzygium Aromaticum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2014.884779 - 3. Outgoing r'ship
FOUND_INto/from Trachyspermum Ammi (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.831565