Ethyl isobutyrate
PubChem CID: 7342
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ETHYL ISOBUTYRATE, 97-62-1, Ethyl 2-methylpropanoate, Isobutyric acid ethyl ester, Ethylisobutyrate, Ethyl isobutanoate, Propanoic acid, 2-methyl-, ethyl ester, Ethyl 2,2-dimethylacetate, Isobutyric acid, ethyl ester, Ethyl 2-methylpropionate, Ethyl iso-butyrate, FEMA No. 2428, Propionic acid, 2-methyl-, ethyl ester, EINECS 202-595-4, NSC 97194, UN2385, Ethylmethylpropanoate, UNII-9A9661LN4H, BRN 0773846, ethyl methylpropanoate, CHEBI:87303, AI3-06121, 2-methylpropanoic acid ethyl ester, Ethyl-2-methylproanoate, ethyl 2-methyl-propionyl, NSC-97194, ETHYL ISOBUTYRATE [MI], Ethyl 2-methylpropanoate, 9CI, ETHYL ISOBUTYRATE [FCC], DTXSID7047728, ETHYL ISOBUTYRATE [FHFI], FEMA 2428, 9A9661LN4H, 2-methyl-propanoic acid ethyl ester, ISO BUTYRIC ACID ETHYL ESTER, Ethyl ester of 2-methyl-propanoic acid, UN 2385, WE(2:0/3:0(2Me)), Ethyl isobutyrate (natural), 2-methyl-propionic acid ethyl ester, MFCD00009165, Ethyl 2methylpropanoate, Ethyl 2methylpropionate, Isobutyrate ethyl ester, Ethyl 2,2dimethylacetate, Ethyl isobutyrate, 99%, isobutanoic acid ethyl ester, Ethyl 2-methylpropanoic acid, SCHEMBL80284, Ethyl 2,2-dimethylacetic acid, CHEMBL295870, WLN: 2OVY1&1, DTXCID6027717, 2Methylpropanoic acid ethyl ester, 2Methylpropionic acid ethyl ester, 2-methylpropionic acid ethyl ester, 2-methylpropanoic acid, ethyl ester, NSC97194, LMFA07010503, Ethyl isobutyrate, analytical standard, Propanoic acid, 2methyl, ethyl ester, Propionic acid, 2methyl, ethyl ester, AKOS008948132, Ethyl isobutyrate, >=98%, FCC, FG, BS-24579, FE139442, I0105, NS00012423, EN300-45229, Ethyl isobutyrate, natural, >=98%, FCC, FG, Ethyl isobutyrate [UN2385] [Flammable liquid], Q27159510, 202-595-4 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCOC=O)CC)C |
| Heavy Atom Count | 8.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Description | Present in many fruits, e.g. apple, banana, orange, wine grape, strawberry, nectarine. Flavouring agent. Ethyl 2-methylpropanoate is found in many foods, some of which are pomes, citrus, fruits, and spearmint. |
| Classyfire Subclass | Carboxylic acid derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 76.6 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | ethyl 2-methylpropanoate |
| Nih Violation | False |
| Prediction Hob | 0.0 |
| Class | Carboxylic acids and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | 1.5 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Carboxylic acid derivatives |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | WDAXFOBOLVPGLV-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.8333333333333334 |
| Rotatable Bond Count | 3.0 |
| State | Liquid |
| Synonyms | Ethyl 2-methylpropanoate, 9CI, Ethyl 2-methylpropionate, Ethyl 2,2-dimethylacetate, Ethyl ester of 2-methyl-propanoic acid, Ethyl isobutanoate, Ethyl isobutyrate, Ethyl-2-methylproanoate, Ethylisobutyrate, Ethylmethylpropanoate, FEMA 2428, Isobutyrate ethyl ester, Isobutyric acid, ethyl ester, Propanoic acid, 2-methyl-, ethyl ester, Propionic acid, 2-methyl-, ethyl ester, Isobutyric acid ethyl ester, Ethyl 2,2-dimethylacetic acid, Ethyl 2-methylpropanoic acid, Ethyl 2-methylpropanoate, 9ci, Ethyl ester OF 2-methyl-propanoic acid, Ethyl 2-methylpropanoate, ethyl 2-methylpropanoate, ethyl isobutyrate |
| Substituent Name | Carboxylic acid ester, Monocarboxylic acid or derivatives, Ether, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic acyclic compound |
| Esol Class | Very soluble |
| Functional Groups | COC(C)=O |
| Compound Name | Ethyl isobutyrate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 116.084 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 116.084 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 116.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -1.3197919999999999 |
| Inchi | InChI=1S/C6H12O2/c1-4-8-6(7)5(2)3/h5H,4H2,1-3H3 |
| Smiles | CCOC(=O)C(C)C |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Carboxylic acid esters |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Actinidia Arguta (Plant) Rel Props:Reference:https://doi.org/10.1016/s0031-9422(03)00142-0 - 2. Outgoing r'ship
FOUND_INto/from Ananas Comosus (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Cassia Grandis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2010.9700409 - 4. Outgoing r'ship
FOUND_INto/from Citrus Nobilis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1790 - 5. Outgoing r'ship
FOUND_INto/from Citrus Reticulata (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1790 - 6. Outgoing r'ship
FOUND_INto/from Citrus Sinensis (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1931 - 7. Outgoing r'ship
FOUND_INto/from Dimocarpus Longan (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199607)11:4<223::aid-ffj579>3.0.co;2-b - 8. Outgoing r'ship
FOUND_INto/from Durio Zibethinus (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730100205 - 9. Outgoing r'ship
FOUND_INto/from Ficus Carica (Plant) Rel Props:Source_db:fooddb_chem_all - 10. Outgoing r'ship
FOUND_INto/from Fragaria Vesca (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3095 - 11. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/10820098 - 12. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Lansium Parasiticum (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730090608 - 14. Outgoing r'ship
FOUND_INto/from Laurus Nobilis (Plant) Rel Props:Source_db:fooddb_chem_all - 15. Outgoing r'ship
FOUND_INto/from Malus Domestica (Plant) Rel Props:Source_db:fooddb_chem_all - 16. Outgoing r'ship
FOUND_INto/from Mentha Spicata (Plant) Rel Props:Source_db:fooddb_chem_all - 17. Outgoing r'ship
FOUND_INto/from Myrtus Communis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1998.9700988 - 18. Outgoing r'ship
FOUND_INto/from Scutellaria Baicalensis (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2009.10643741 - 19. Outgoing r'ship
FOUND_INto/from Seriphidium Brevifolium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1992.9698005 - 20. Outgoing r'ship
FOUND_INto/from Spondias Dulcis (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2001.9699686 - 21. Outgoing r'ship
FOUND_INto/from Vitis Vinifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all