Dihydrozeatin O-beta-D-Glucoside
PubChem CID: 73036075
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Dihydrozeatin O-beta-D-Glucoside |
|---|---|
| Topological Polar Surface Area | 166.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | QRZHDHJUYBONQQ-UHFFFAOYSA-N |
| Rotatable Bond Count | 8.0 |
| Heavy Atom Count | 27.0 |
| Compound Name | Dihydrozeatin O-beta-D-Glucoside |
| Description | Dihydrozeatin o-beta-d-glucoside is a member of the class of compounds known as fatty acyl glycosides of mono- and disaccharides. Fatty acyl glycosides of mono- and disaccharides are compounds composed of a mono- or disaccharide moiety linked to one hydroxyl group of a fatty alcohol or of a phosphorylated alcohol (phosphoprenols), a hydroxy fatty acid or to one carboxyl group of a fatty acid (ester linkage) or to an amino alcohol. Dihydrozeatin o-beta-d-glucoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Dihydrozeatin o-beta-d-glucoside can be found in soy bean, which makes dihydrozeatin o-beta-d-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 383.18 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 383.18 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 463.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 383.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(hydroxymethyl)-6-[2-methyl-4-(7H-purin-6-ylamino)butoxy]oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 6.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C16H25N5O6/c1-8(2-3-17-14-10-15(19-6-18-10)21-7-20-14)5-26-16-13(25)12(24)11(23)9(4-22)27-16/h6-9,11-13,16,22-25H,2-5H2,1H3,(H2,17,18,19,20,21) |
| Smiles | CC(CCNC1=NC=NC2=C1NC=N2)COC3C(C(C(C(O3)CO)O)O)O |
| Xlogp | -0.7 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C16H25N5O6 |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all