Cyanidin 3-O-rhamnoside
PubChem CID: 72812405
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cyanidin 3-O-rhamnoside, Cyanidin 3-alpha-L-rhamnoside, Cyanidin 3-O-alpha-L-rhamnoside, CHEBI:176110, 2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| Topological Polar Surface Area | 161.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Inchi Key | USWXMMRFOWNEOR-UHFFFAOYSA-O |
| Rotatable Bond Count | 3.0 |
| Synonyms | Cyanidin 3-alpha-L-rhamnoside, Cyanidin 3-O-alpha-L-rhamnoside, Cyanidin 3-O-rhamnoside, Cyanidin 3-rhamnoside |
| Heavy Atom Count | 31.0 |
| Compound Name | Cyanidin 3-O-rhamnoside |
| Kingdom | Organic compounds |
| Description | Isolated from various plant subspecies, e.g. Chamaecyparis species and Plumbago rosea [CCD]. Cyanidin 3-rhamnoside is found in common pea and blackcurrant. |
| Exact Mass | 433.113 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 433.113 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 607.0 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 433.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Uniprot Id | P21964 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromenylium-3-yl]oxy-6-methyloxane-3,4,5-triol |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Class | Flavonoids |
| Inchi | InChI=1S/C21H20O10/c1-8-17(26)18(27)19(28)21(29-8)31-16-7-11-13(24)5-10(22)6-15(11)30-20(16)9-2-3-12(23)14(25)4-9/h2-8,17-19,21,26-28H,1H3,(H3-,22,23,24,25)/p+1 |
| Smiles | CC1C(C(C(C(O1)OC2=CC3=C(C=C(C=C3[O+]=C2C4=CC(=C(C=C4)O)O)O)O)O)O)O |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | True |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Flavonoid glycosides |
| Taxonomy Direct Parent | Anthocyanidin-3-O-glycosides |
| Molecular Formula | C21H21O10+ |
- 1. Outgoing r'ship
FOUND_INto/from Pisum Sativum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Ribes Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all