(-)-Cappariloside A
PubChem CID: 72761836
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cappariloside A, (-)-Cappariloside A |
|---|---|
| Topological Polar Surface Area | 139.0 |
| Hydrogen Bond Donor Count | 5.0 |
| Inchi Key | ZVFUTZQNUQUJLW-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | (-)-Cappariloside A, Cappariloside A |
| Heavy Atom Count | 24.0 |
| Compound Name | (-)-Cappariloside A |
| Description | Constituent of the fruit of Capparis spinosa (caper). Cappariloside A is found in capers and herbs and spices. |
| Exact Mass | 334.116 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 334.116 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 482.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 334.32 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indol-3-yl]acetonitrile |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C16H18N2O6/c17-5-4-8-6-18-9-2-1-3-10(12(8)9)23-16-15(22)14(21)13(20)11(7-19)24-16/h1-3,6,11,13-16,18-22H,4,7H2 |
| Smiles | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=CN2)CC#N |
| Xlogp | -0.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C16H18N2O6 |
- 1. Outgoing r'ship
FOUND_INto/from Capparis Spinosa (Plant) Rel Props:Source_db:fooddb_chem_all