(-)-Pinocampheol
PubChem CID: 7271803
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (-)-Pinocampheol, l-Pinocampheo, (-)-3beta-Hydroxy-10alpha-pinane, EINECS 252-827-3, 35997-96-7, (1S-(1alpha,2alpha,3beta,5alpha))-2,6,6-Trimethylbicyclo(3.1.1)heptan-3-ol, Bicyclo(3.1.1)heptan-3-ol, 2,6,6-trimethyl-, (1S-(1alpha,2alpha,3beta,5alpha))-, (1alpha,2alpha,3beta,5alpha)-2,6,6-Trimethylbicyclo(3.1.1)heptan-3-ol, Bicyclo(3.1.1)heptan-3-ol, 2,6,6-trimethyl-, (1alpha,2alpha,3beta,5alpha)-, 25465-95-6, NS00084018, (1S,2R,3R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 11.0 |
| Description | Occurs in oils of Hyssopus officinalis (hyssop). (-)-Pinocampheol is found in hyssop and herbs and spices. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 174.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (1S,2R,3R,5R)-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol |
| Nih Violation | False |
| Class | Prenol lipids |
| Xlogp | 2.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Monoterpenoids |
| Molecular Formula | C10H18O |
| Inchi Key | REPVLJRCJUVQFA-LURQLKTLSA-N |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Synonyms | (-)-Pinocampheol |
| Compound Name | (-)-Pinocampheol |
| Kingdom | Organic compounds |
| Exact Mass | 154.136 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 154.136 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 154.25 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Inchi | InChI=1S/C10H18O/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9,11H,4-5H2,1-3H3/t6-,7-,8+,9-/m1/s1 |
| Smiles | C[C@@H]1[C@@H]2C[C@@H](C2(C)C)C[C@H]1O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Bicyclic monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Hyssopus Officinalis (Plant) Rel Props:Source_db:fooddb_chem_all