Inophyllum B
PubChem CID: 72412
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Inophyllum B, 41135-06-2, CHEMBL337029, (16R,17S,18S)-18-hydroxy-10,10,16,17-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaen-4-one, hydroxy-tetramethyl-phenyl-[?]one, SCHEMBL2040583, DTXSID60194070, 12-Hydroxy-6,6,10,11-tetramethyl-4-phenyl-11,12-dihydro-6H,10H-dipyrano[2,3-f, 2'',3''-h]chromen-2-one, BDBM50029982, NSC664738, DA-74492, HY-142074, CS-0373940, (2R,3R,4S)-4-Hydroxy-2,3,10,10-tetramethyl-8-phenyl-2H-pyrano[6,5-f]2H-pyrano[6,5-h]chroman-6-one, 2H,6H,10H-Benzo(1,2-b:3,4-b':5,6-b'')tripyran-2-one, 11,12-dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-phenyl-, (10alpha,11beta,12alpha)-(+)- |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 65.0 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(C2CCCCC2)C2C3CCCCC3C3CCCCC3C2C1 |
| Np Classifier Class | Pyranocoumarins, Simple coumarins |
| Deep Smiles | C[C@H]OccC=CCOc6ccc%10[C@H][C@@H]%14C))O)))oc=O)cc6cccccc6))))))))))))))C)C |
| Heavy Atom Count | 30.0 |
| Classyfire Class | Neoflavonoids |
| Scaffold Graph Node Level | OC1CC(C2CCCCC2)C2C3OCCCC3C3OCCCC3C2O1 |
| Classyfire Subclass | Prenylated neoflavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 749.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Uniprot Id | Q72547, n.a. |
| Iupac Name | (16R,17S,18S)-18-hydroxy-10,10,16,17-tetramethyl-6-phenyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8(13),11-pentaen-4-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 4.1 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C25H24O5 |
| Scaffold Graph Node Bond Level | O=c1cc(-c2ccccc2)c2c3c(c4c(c2o1)CCCO4)C=CCO3 |
| Prediction Swissadme | 1.0 |
| Inchi Key | BXENDTPSKAICGV-LKBUQDJMSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.32 |
| Logs | -3.637 |
| Rotatable Bond Count | 1.0 |
| Logd | 4.401 |
| Synonyms | inophyllum b |
| Esol Class | Moderately soluble |
| Functional Groups | CO, c=O, cC=CC, cOC, coc |
| Compound Name | Inophyllum B |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 404.162 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 404.162 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 404.5 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.837231066666668 |
| Inchi | InChI=1S/C25H24O5/c1-13-14(2)28-22-16-10-11-25(3,4)30-23(16)19-17(15-8-6-5-7-9-15)12-18(26)29-24(19)20(22)21(13)27/h5-14,21,27H,1-4H3/t13-,14-,21+/m1/s1 |
| Smiles | C[C@@H]1[C@H](OC2=C([C@H]1O)C3=C(C(=CC(=O)O3)C4=CC=CC=C4)C5=C2C=CC(O5)(C)C)C |
| Nring | 5.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Calophyllum Apetalum (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Calophyllum Austroindicum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Calophyllum Brasiliense (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Calophyllum Calaba (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Calophyllum Caledonicum (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Calophyllum Dispar (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Calophyllum Inophyllum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Calophyllum Lanigerum (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Calophyllum Moonii (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Calophyllum Polyanthum (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Calophyllum Soulattri (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Calophyllum Teysmannii (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Calophyllum Thwaitesii (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Calophyllum Tomentosum (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Calophyllum Trapezifolium (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Jasminum Calophyllum (Plant) Rel Props:Reference: