Tetracos-20-ene-1,18-diol
PubChem CID: 71346384
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 20-Tetracosene-1,18-diol, TETRACOS-20-ENE-1,18-DIOL, 151454-15-8, DTXSID60772478, DTXCID40723221, CHEBI:180070 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty alcohols |
| Deep Smiles | OCCCCCCCCCCCCCCCCCCCC=CCCC))))))O |
| Heavy Atom Count | 26.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 275.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | tetracos-20-ene-1,18-diol |
| Nih Violation | True |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 9.2 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C24H48O2 |
| Inchi Key | JYZDOSWMZPZDMV-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 21.0 |
| Synonyms | tetracos-20-en-1,18-diol |
| Esol Class | Poorly soluble |
| Functional Groups | CC=CC, CO |
| Compound Name | Tetracos-20-ene-1,18-diol |
| Exact Mass | 368.365 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 368.365 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 368.6 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C24H48O2/c1-2-3-4-18-21-24(26)22-19-16-14-12-10-8-6-5-7-9-11-13-15-17-20-23-25/h4,18,24-26H,2-3,5-17,19-23H2,1H3 |
| Smiles | CCCC=CCC(CCCCCCCCCCCCCCCCCO)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Colocasia Esculenta (Plant) Rel Props:Reference:ISBN:9788172362133; ISBN:9788185042145