Benzidine
PubChem CID: 7111
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | BENZIDINE, 92-87-5, 4,4'-Diaminobiphenyl, [1,1'-Biphenyl]-4,4'-diamine, p-Diaminodiphenyl, 4-(4-aminophenyl)aniline, 4,4'-Bianiline, biphenyl-4,4'-diamine, 4,4'-Biphenyldiamine, 4,4'-Diaminodiphenyl, p,p-Bianiline, p,p'-Diaminobiphenyl, 4,4'-Biphenylenediamine, 4,4'-Diphenylenediamine, Fast Corinth Base B, p,p'-Dianiline, Benzidin, Benzidina, Benzydyna, p,p'-Bianiline, Benzioine, Benzidine base, C.I. Azoic Diazo Component 112, p-Benzidine, (1,1'-Biphenyl)-4,4'-diamine, RCRA waste number U021, 4,4'-Diamino-1,1'-biphenyl, Benzidin [Czech], Benzydyna [Polish], Benzidina [Italian], 1,1'-Biphenyl-4,4'-Diamine, Biphenyl, 4,4'-diamino-, NCI-C03361, CCRIS 71, HSDB 948, CI Azoic diazo component 112, NSC 146476, Biphenyl,4,4'-diamino-, C.I. 37225, EINECS 202-199-1, UN1885, UNII-2X02101HVF, Benzidine, 95%, BRN 0742770, p,p'-diaminodiphenyl, CI 37225, DTXSID2020137, CHEBI:80495, AI3-00140, 2X02101HVF, BENZIDINE [MI], BENZIDINE [HSDB], BENZIDINE [IARC], MFCD00039765, 4, 4'-Biphenylenediamine, NSC-146476, biphenyl -4,4'-ylenediamine, DTXCID80137, BIPHENYL,4,4'-DIAMINO, 4-13-00-00364 (Beilstein Handbook Reference), NSC146476, UN 1885, {[1,} 1'-Biphenyl]-4,4'-diamine, BENZIDIN (CZECH), BENZIDINE (IARC), BENZIDINE, DYES METABOLIZED TO [IARC], BENZYDYNA (POLISH), BENZIDINA (ITALIAN), PHENYLBUTAZONE IMPURITY E [EP IMPURITY], 4'-amino(1,1'-biphenyl)-4-ylamine, 4'-Amino[1,1'-biphenyl]-4-ylamine, ((1,) 1'-Biphenyl)-4,4'-diamine, CAS-92-87-5, Benzidine Solution in Methanol, 100ug/mL, BENZIDINE, DYES METABOLIZED TO (IARC), PHENYLBUTAZONE IMPURITY E (EP IMPURITY), RCRA waste no. U021, pBenzidine, pDiaminodiphenyl, p,pBianiline, p,p'Dianiline, p,p'Diaminobiphenyl, 4,4'Bianiline, 4,4'-Benzidine, 4,4'diaminobiphenyl, 4,4'Biphenyldiamine, 4,4'Diaminodiphenyl, 4,4'-Diamonophenyl, [1,4'-diamine, Biphenyl,4'-diamino-, 4,4'Biphenylenediamine, 4,4'Diphenylenediamine, 4.4'- diaminobiphenyl, Biphenyl, 4,4'diamino, WLN: ZR DR DZ, Benzidine (ACGIH:OSHA), 4,4'Diamino1,1'biphenyl, Biphenyl-4,4'-ylenediamine, Oprea1_312205, SCHEMBL29021, YSWG265, 1,1'Biphenyl)4,4'diamine, MLS002303016, Benzidine, analytical standard, BIDD:GT0832, CHEMBL15901, IFLab1_004231, Benzidine, >=98.0% (N), HMS3091M16, Benzidine [UN1885] [Poison], [4-(4-aminophenyl)-phenyl]-amine, Tox21_202359, Tox21_300405, BBL013163, MSK1202-100M, STK317796, AKOS000118878, AKOS016402822, CCG-202856, FB18197, 4,4a(2)-Diamino-1,1a(2)-biphenyl, IDI1_009986, NCGC00091340-01, NCGC00091340-02, NCGC00091340-03, NCGC00254474-01, NCGC00259908-01, 1ST1202-100M, 4'-Amino[1,1'-biphenyl]-4-ylamine #, AS-17227, SMR000033596, (1,1'-Biphenyl)-4,4'-diamine (9CI), Benzidine, purum p.a., >=98.0% (N), DB-057341, Benzidine 2000 microg/mL in Dichloromethane, Benzidine, ISOPAC(R), >=98.0% (N), NS00010863, 4,4'-Benzidine 10 microg/mL in Acetonitrile, EN300-18328, 4,4'-Benzidine 100 microg/mL in Acetonitrile, A844372, AC-907/25014310, Q410066, SR-01000596939, [1,1'-biphenyl]-4,4'-diamine (ACD/Name 4.0), SR-01000596939-1, Z57901921, 4'-Amino[1,1'-biphenyl]-4-ylamine (ACD/Name 4.0), F1679-0261, Benzidine Solution, 2000 in Dichloromethane, 1 mL second source, [1,1'-Biphenyl]-4,4'-diamine, 4,4'-Bianiline, 4,4'-Biphenyldiamine, 202-199-1, 26997-10-4 |
|---|---|
| Topological Polar Surface Area | 52.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 14.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 145.0 |
| Database Name | cmaup_ingredients;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P22310, Q9NUW8, P00352, P04637, P08684, P10828, P35503, Q9H0H5, O94925, P63092, Q9R1A7, P10275 |
| Iupac Name | 4-(4-aminophenyl)aniline |
| Prediction Hob | 1.0 |
| Target Id | NPT50, NPT94, NPT539, NPT109 |
| Xlogp | 1.3 |
| Molecular Formula | C12H12N2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | HFACYLZERDEVSX-UHFFFAOYSA-N |
| Fcsp3 | 0.0 |
| Logs | -2.279 |
| Rotatable Bond Count | 1.0 |
| Logd | 1.677 |
| Compound Name | Benzidine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 184.1 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 184.1 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 184.24 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -2.394786114285714 |
| Inchi | InChI=1S/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H2 |
| Smiles | C1=CC(=CC=C1C2=CC=C(C=C2)N)N |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Typha Angustifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Typha Orientalis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all