D-Ornithine
PubChem CID: 71082
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-ornithine, 348-66-3, (2R)-2,5-diaminopentanoic acid, (R)-ornithine, Ornithine, D-, (r)-2,5-diaminopentanoic acid, UNII-2H368YCK0U, 2H368YCK0U, CHEBI:16176, EINECS 206-482-0, R-(-)-ORNITHINE, D-2,5-Diaminopentanoic acid, (2R)-2,5-diaminopentanoate, DTXSID30883368, D-Ornitrine, ORD, D-Orn, bmse000019, bmse000897, NCIStruc1_000044, NCIStruc2_000122, SCHEMBL43724, (r)-2,5-diaminopentanoicacid, CHEMBL103686, GTPL4682, DTXCID501022905, CCG-38067, NCGC00014201, NCI118360, AKOS027323605, NCGC00014201-02, NCGC00014201-03, NCGC00097310-01, NCGC00097310-02, (2R)-2,5-diaminopentanoic acid, CPD-217, DB-297245, NS00100732, EN300-67290, C00515, Q27077099, DC1ED507-B262-41A6-BDD0-49ED6DE5E235 |
|---|---|
| Topological Polar Surface Area | 89.3 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 9.0 |
| Pathway Kegg Map Id | map00472 |
| Description | An amino acid produced in the urea cycle by the splitting off of urea from arginine. Ornithine is one of the products of the action of the enzyme arginase on L-arginine, creating urea. Therefore, ornithine is a central part of the urea cycle, which allows for the disposal of excess nitrogen. [HMDB] |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 95.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Uniprot Id | P14920, n.a., Q99714, Q9F4F7, P09057 |
| Iupac Name | (2R)-2,5-diaminopentanoic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Target Id | NPT149 |
| Xlogp | -4.4 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C5H12N2O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AHLPHDHHMVZTML-SCSAIBSYSA-N |
| Fcsp3 | 0.8 |
| Logs | -0.354 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | -1.786 |
| Synonyms | (2R)-2,5-diaminopentanoate, (2R)-2,5-diaminopentanoic acid, (R)-ornithine, Ornithine, (R)-Ornithine, (2R)-2,5-Diaminopentanoate, (2R)-2,5-Diaminopentanoic acid |
| Compound Name | D-Ornithine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 132.09 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 132.09 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 132.16 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 2.3828894000000007 |
| Inchi | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m1/s1 |
| Smiles | C(C[C@H](C(=O)O)N)CN |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | D-alpha-amino acids |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Angelica Acutiloba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Angelica Gigas (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Angelica Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Lycium Barbarum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Lycium Chinense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all