Nonanamide
PubChem CID: 70709
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Nonanamide, 1120-07-6, Pelargonamide, Nonamide, Nonan-1-amide, pelargonic amide, NSC 5415, NSC-5415, EINECS 214-297-1, AI3-05052, 0L1759048J, DTXSID60149803, heptylacetamide, non-amide, Nonan1amide, n-heptyl acetamide, UNII-0L1759048J, Nonanoic acid amide, Nonanamide (8CI), NONANOAMIDE, Nonanamide (8CI)(9CI), SCHEMBL38252, CHEMBL353209, DTXCID3072294, NSC5415, BAA12007, STL371141, AKOS009164854, HS-6375, DB-041029, NS00021525, EN300-72235, Q6044624, Z296759818 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 43.1 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Primary amides |
| Deep Smiles | CCCCCCCCC=O)N |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty amides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 102.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | nonanamide |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.9 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C9H19NO |
| Inchi Key | GHLZUHZBBNDWHW-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 7.0 |
| Synonyms | nonanamide |
| Esol Class | Soluble |
| Functional Groups | CC(N)=O |
| Compound Name | Nonanamide |
| Exact Mass | 157.147 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 157.147 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 157.25 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C9H19NO/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H2,10,11) |
| Smiles | CCCCCCCCC(=O)N |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty amides |
- 1. Outgoing r'ship
FOUND_INto/from Eruca Vesicaria (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1079