6-Methylquinoline
PubChem CID: 7059
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 6-METHYLQUINOLINE, 91-62-3, p-Toluquinoline, Quinoline, 6-methyl-, 6-methyl-Quinoline, Tolliquinoline, p-, FEMA No. 2744, CCRIS 407, NSC 4152, 6-methyl quinoline, p-Tolliquinoline, EINECS 202-084-6, BRN 0110336, DTXSID3020887, UNII-K14453I13N, AI3-08869, NSC-4152, K14453I13N, METHYLQUINOLINE, 6-, DTXCID50887, FEMA 2744, 6-METHYLQUINOLINE [FHFI], 5-20-07-00400 (Beilstein Handbook Reference), Quinoline, 6-methyl- (8CI,9CI), CAS-91-62-3, MFCD00006804, 6-Methylquinoline, 98%, MLS002303009, SCHEMBL130884, NISTC91623, CHEMBL1412508, NSC4152, CHEBI:140761, Quinoline, 6-methyl-(8ci,9ci), 6-Methylquinoline, >=98%, FG, HMS3039C14, Tox21_202379, Tox21_300320, 6-Methylquinoline, analytical standard, AKOS005207038, AC-5219, NCGC00091226-01, NCGC00091226-02, NCGC00091226-03, NCGC00253998-01, NCGC00259928-01, AS-11473, SMR001307317, DB-011140, M0416, NS00012991, EN300-28823, AC-907/25014269, Q27281809, Z277960616, 202-084-6 |
|---|---|
| Topological Polar Surface Area | 12.9 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 11.0 |
| Description | Flavouring ingredient. 6-Methylquinoline is found in tea. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 133.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-methylquinoline |
| Nih Violation | False |
| Class | Quinolines and derivatives |
| Xlogp | 2.6 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Molecular Formula | C10H9N |
| Inchi Key | LUYISICIYVKBTA-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| State | Liquid |
| Synonyms | 6-Methyl-quinoline, FEMA 2744, P-Tolliquinoline, p-Toluquinoline, Quinoline, 6-methyl-, Quinoline, 6-methyl- (8CI,9CI), Tolliquinoline, p-, P-Toluquinoline, Quinoline, 6-methyl- (8ci,9ci) |
| Substituent Name | Quinoline, Nitrotoluene, Benzenoid, Pyridine, Heteroaromatic compound, Azacycle, Hydrocarbon derivative, Organonitrogen compound, Aromatic heteropolycyclic compound |
| Compound Name | 6-Methylquinoline |
| Kingdom | Organic compounds |
| Exact Mass | 143.073 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 143.073 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 143.18 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Inchi | InChI=1S/C10H9N/c1-8-4-5-10-9(7-8)3-2-6-11-10/h2-7H,1H3 |
| Smiles | CC1=CC2=C(C=C1)N=CC=C2 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Quinolines and derivatives |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all