2-Amino-8-hydroxynaphthalene-6-sulfonic acid
PubChem CID: 7022
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 90-51-7, 6-AMINO-4-HYDROXY-2-NAPHTHALENESULFONIC ACID, 6-amino-4-hydroxynaphthalene-2-sulfonic acid, 2-Amino-8-naphthol-6-sulfonic Acid, Gamma Acid, gamma-Acid, C.I. Developer 3, 2-Naphthalenesulfonic acid, 6-amino-4-hydroxy-, Y acid, 7-Amino-1-naphthol-3-sulfonic acid, .gamma.-Acid, Aminonaphthol sulfonic acid gamma, 1-Naphthol-3-sulfonic acid, 7-amino-, EINECS 202-000-8, 2-amino-8-hydroxynaphthalene-6-sulfonic acid, NSC 31508, BRN 1821283, 0PLB93P56X, DTXSID0026547, AI3-19502, CI DEVELOPER 3, 6-Amino-4-hydroxynaphthalene-2-sulphonic acid, MFCD00003973, NSC-31508, 2-amino-6-sulfo-8-naphthol, 6-Amino-4-hydroxy-2-naphthalenesulfonic acid (gamma acid), DTXCID606547, CHEMBL3087995, EC 202-000-8, 6-amino-4-naphthol-2-sulfonic acid, 2-amino-8-hydroxy-6-sulfonaphthalene, 90459-13-5, AMINONAPHTHOL SULFONIC ACID .GAMMA., 1-NAPHTHOL-7-AMINO-3-SULFONIC ACID, 7-AMINO-1-HYDROXY-3-NAPHTHALENESULFONIC ACID, Aminonaphthol sulfonic acid, .gamma.-, UNII-0PLB93P56X, 6-Amino-4-hydroxy-2-naphthalenesulfonic acid (.gamma. acid), G-Saure, 6-Amino-4-hydroxy-2-naphthalenesulfonicAcid, 6-amino-4-hydroxy-naphthalene-2-sulfonic acid, 94552-33-7, SCHEMBL156692, NSC8630, NSC-8630, NSC31508, Tox21_200078, BDBM50443532, STK368430, AKOS005444391, CS-W012819, CAS-90-51-7, NCGC00248514-01, NCGC00257632-01, SY051570, DB-057209, A0371, NS00009937, 1-hydroxy-7-aminonaphthalene-3-sulphonic acid, 7-amino-1-hydroxy-3-naphthalene sulfonic acid, D70648, 6-azanyl-4-oxidanyl-naphthalene-2-sulfonic acid, SR-01000310329, SR-01000310329-1, Q27237069, 6-Amino-4-hydroxy-2-naphthalenesulfonic acid, technical, >=90% (T), 2-Naphthalenesulfonic acid,6-amino-4-hydroxy-,coupled with diazotized 5-amino-2-[(4-aminophenyl)amino]benzenesulfonic acid,diazotized,coupled with m-phenylenediamine,sodium salts, 2-Naphthalenesulfonic acid,6-amino-4-hydroxy-,diazotized,coupled with diazotized 4-aminobenzenesulfonic acid,diazotized aniline and resorcinol, VWO |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 109.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | C1CCC2CCCCC2C1 |
| Deep Smiles | Ncccccc6)cO)ccc6)S=O)=O)O |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Naphthalenes |
| Scaffold Graph Node Level | C1CCC2CCCCC2C1 |
| Classyfire Subclass | Naphthalene sulfonic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 350.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 6-amino-4-hydroxynaphthalene-2-sulfonic acid |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | -0.9 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H9NO4S |
| Scaffold Graph Node Bond Level | c1ccc2ccccc2c1 |
| Inchi Key | HBZVNWNSRNTWPS-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | gamma-acid |
| Esol Class | Very soluble |
| Functional Groups | cN, cO, cS(=O)(=O)O |
| Compound Name | 2-Amino-8-hydroxynaphthalene-6-sulfonic acid |
| Exact Mass | 239.025 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 239.025 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 239.25 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H9NO4S/c11-7-2-1-6-3-8(16(13,14)15)5-10(12)9(6)4-7/h1-5,12H,11H2,(H,13,14,15) |
| Smiles | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)O)N |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Humulus Lupulus (Plant) Rel Props:Reference:ISBN:9788172360481