gamma-Glutamylmethionine
PubChem CID: 7009567
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-glutamylmethionine, H-Glu(Met-OH)-OH, 17663-87-5, H-GAMMA-GLU-MET-OH, gamma-Glu-Met, (2S)-2-amino-5-[[(1S)-1-carboxy-3-methylsulfanylpropyl]amino]-5-oxopentanoic acid, gamma-L-glutamyl-L-methionine, MFCD00037214, I(3)-Glutamylmethionine, L-gamma-glutamyl-L-methionine, SCHEMBL237467, CHEBI:82965, DTXSID601315153, DA-53972, FG108919, HY-145779, CS-0432853, Q63399363, N5-((S)-1-Carboxy-3-(methylthio)propyl)-L-glutamine, (2S)-2-amino-5-[[(1S)-1-carboxy-3-methylsulfanyl-propyl]amino]-5-oxo-pentanoic acid |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 155.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | True |
| Np Classifier Class | Dipeptides |
| Deep Smiles | CSCC[C@@H]C=O)O))NC=O)CC[C@@H]C=O)O))N |
| Heavy Atom Count | 18.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 311.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2S)-2-amino-5-[[(1S)-1-carboxy-3-methylsulfanylpropyl]amino]-5-oxopentanoic acid |
| Class | Carboxylic acids and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -3.1 |
| Superclass | Organic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H18N2O5S |
| Inchi Key | RQNSKRXMANOPQY-BQBZGAKWSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 9.0 |
| State | Solid |
| Synonyms | g-Glutamylmethionine, Γ-glutamylmethionine, γ-Glu-Met, γ-L-Glu-L-Met, γ-L-Glutamyl-L-methionine, L-γ-Glutamyl-L-methionine, N-γ-Glutamylmethionine, N-L-γ-Glutamylmethionine, N-L-γ-Glutamyl-L-methionine, gamma-Glu-Met, gamma-L-Glu-L-Met, gamma-L-Glutamyl-L-methionine, L-gamma-Glutamyl-L-methionine, N-gamma-Glutamylmethionine, N-L-gamma-Glutamylmethionine, N-L-gamma-Glutamyl-L-methionine, gamma-Glutamylmethionine, N-γ-L-Glutamyl-L-methionine, N-gamma-L-Glutamyl-L-methionine, g-Glu-met, N-g-L-Glutamyl-L-methionine, gamma-glu-met, l-l-gamma-glutamylmethionine |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)NC, CC(=O)O, CN, CSC |
| Compound Name | gamma-Glutamylmethionine |
| Kingdom | Organic compounds |
| Exact Mass | 278.094 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 278.094 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 278.33 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H18N2O5S/c1-18-5-4-7(10(16)17)12-8(13)3-2-6(11)9(14)15/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t6-,7-/m0/s1 |
| Smiles | CSCC[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Dipeptides |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Allium Ascalonicum (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 2. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 3. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 4. Outgoing r'ship
FOUND_INto/from Vigna Mungo (Plant) Rel Props:Reference:ISBN:9788171360536 - 5. Outgoing r'ship
FOUND_INto/from Vigna Radiata (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729