Octadecyl acetate
PubChem CID: 69968
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Octadecyl acetate, Stearyl acetate, 822-23-1, Acetic acid, octadecyl ester, 1-Octadecanol acetate, Acetic acid n-octadecyl ester, n-Octadecyl ethanoate, Octadecylacetate, Acetic acid stearyl ester, Octadecanol acetate, n-Octadecyl acetate, 1-Octadecyl acetate, UNII-A8005KSX95, STEARYLACETATE, A8005KSX95, NSC 5546, NSC-5546, EINECS 212-493-1, MFCD00043649, AEC STEARYL ACETATE, AI3-08310, DTXSID4047759, Acetic Acid Octadecyl Ester, Octadecyl acetic acid, Stearyl acetate, >=99%, SCHEMBL131668, STEARYL ACETATE [INCI], DTXCID3027742, NSC5546, CHEBI:179720, LMFA07010398, AKOS015839802, FS-4060, HY-W127605, A0675, CS-0185813, NS00014120, D88305, Q27273742, 1-Octadecanol Acetate, 1-Octadecyl Acetate, NSC 5546, Octadecyl Acetate, Stearyl Acetate, n-Octadecyl Acetate |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Wax monoesters |
| Deep Smiles | CCCCCCCCCCCCCCCCCCOC=O)C |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty alcohol esters |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 226.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | octadecyl acetate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 8.8 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C20H40O2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | OIZXRZCQJDXPFO-UHFFFAOYSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.95 |
| Logs | -6.925 |
| Rotatable Bond Count | 18.0 |
| Logd | 4.22 |
| Synonyms | octadecanol acetate, octadecyl acetate, stearyl acetate |
| Esol Class | Poorly soluble |
| Functional Groups | COC(C)=O |
| Compound Name | Octadecyl acetate |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 312.303 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 312.303 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 312.5 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -6.1526356 |
| Inchi | InChI=1S/C20H40O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-20(2)21/h3-19H2,1-2H3 |
| Smiles | CCCCCCCCCCCCCCCCCCOC(=O)C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Fatty esters |
- 1. Outgoing r'ship
FOUND_INto/from Abies Alba (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Anthriscus Sylvestris (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2015.1060176 - 3. Outgoing r'ship
FOUND_INto/from Avicennia Alba (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Basella Alba (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Brassica Alba (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Bryonia Alba (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Caltha Alba (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Canella Alba (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Cepa Alba (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Chiococca Alba (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Cryptocarya Alba (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Datura Alba (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Eclipta Alba (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Eleutherococcus Giraldii (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Eleutherococcus Gracilistylus (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Eleutherococcus Senticosus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Eleutherococcus Sessiliflorus (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Eleutherococcus Trifoliatus (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Eria Alba (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Eucalyptus Alba (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Euphorbia Helioscopia (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1148 - 22. Outgoing r'ship
FOUND_INto/from Ipomoea Alba (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Lawsonia Alba (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Lippia Alba (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Melilotus Alba (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Michelia Alba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 27. Outgoing r'ship
FOUND_INto/from Michelia Champaca (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Michelia Compressa (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Michelia Lanuginosa (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Michelia Longifolia (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Michelia Rajaniana (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Michelia Yunnanensis (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Morus Alba (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Nymphaea Alba (Plant) Rel Props:Reference: - 35. Outgoing r'ship
FOUND_INto/from Pachira Aquatica (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2019.1571950 - 36. Outgoing r'ship
FOUND_INto/from Plumeria Alba (Plant) Rel Props:Reference: - 37. Outgoing r'ship
FOUND_INto/from Populus Alba (Plant) Rel Props:Reference: - 38. Outgoing r'ship
FOUND_INto/from Potentilla Alba (Plant) Rel Props:Reference: - 39. Outgoing r'ship
FOUND_INto/from Rosa Alba (Plant) Rel Props:Reference: - 40. Outgoing r'ship
FOUND_INto/from Salix Alba (Plant) Rel Props:Reference: - 41. Outgoing r'ship
FOUND_INto/from Sida Alba (Plant) Rel Props:Reference: - 42. Outgoing r'ship
FOUND_INto/from Sinapis Alba (Plant) Rel Props:Reference: - 43. Outgoing r'ship
FOUND_INto/from Sonneratia Alba (Plant) Rel Props:Reference: - 44. Outgoing r'ship
FOUND_INto/from Zinnia Elegans (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2000.9699552