D-Alanylglycine
PubChem CID: 6992371
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | D-Alanylglycine, 3997-90-8, H-D-Ala-Gly-OH, Glycine, D-alanyl-, D-Ala-Gly-OH, D-Ala-Gly, MS27E6YQ4Z, 2-[[(2R)-2-aminopropanoyl]amino]acetic acid, UNII-MS27E6YQ4Z, (R)-2-(2-Aminopropanamido)acetic acid, NSC 522809, Glycine, N-D-alanyl-, 2-[(2R)-2-aminopropanamido]acetic acid, 2-((2R)-2-AMINOPROPANAMIDO)ACETIC ACID, D-ALANYL GLYCINE, 2-(((2R)-2-AMINOPROPANOYL)AMINO)ACETIC ACID, d-Alanyl-glycin, NSC-522809, MFCD00014811, SCHEMBL851239, CHEBI:73836, DTXSID60426308, AKOS017430305, BS-42357, CS-0452128, G84852, Q27144155 |
|---|---|
| Topological Polar Surface Area | 92.4 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | CXISPYVYMQWFLE-GSVOUGTGSA-N |
| Rotatable Bond Count | 3.0 |
| Heavy Atom Count | 10.0 |
| Compound Name | D-Alanylglycine |
| Description | D-alanyl glycine, also known as ag, is a member of the class of compounds known as dipeptides. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. D-alanyl glycine is slightly soluble (in water) and a weakly acidic compound (based on its pKa). D-alanyl glycine can be found in rice, which makes D-alanyl glycine a potential biomarker for the consumption of this food product. |
| Exact Mass | 146.069 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 146.069 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 146.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 146.14 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | 2-[[(2R)-2-aminopropanoyl]amino]acetic acid |
| Total Atom Stereocenter Count | 1.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C5H10N2O3/c1-3(6)5(10)7-2-4(8)9/h3H,2,6H2,1H3,(H,7,10)(H,8,9)/t3-/m1/s1 |
| Smiles | C[C@H](C(=O)NCC(=O)O)N |
| Xlogp | -3.7 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C5H10N2O3 |
- 1. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all