(R)-lipoamide
PubChem CID: 6992093
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (R)-lipoamide, 5-[(3R)-dithiolan-3-yl]pentanamide, CHEBI:83094, 122999-10-4, 5-[(3R)-1,2-dithiolan-3-yl]pentanamide, (R)-(+)-alpha-Lipoic Amide, 5-((3R)-dithiolan-3-yl)pentanamide, 5-((3R)-1,2-dithiolan-3-yl)pentanamide, 6,8-dithiooctanoic amide, Lipoylprotein, DL-.alpha.-Lipoamide, [H-protein]-lipoyllysine, SCHEMBL41833, [GcvH]-N6-lipoyl-L-lysine, [GCSH]-N6-lipoyl-L-lysine, (R)-5-(1,2-Dithiolan-3-yl)pentanamide, C02051, [Glycine cleavage system H]-N6-lipoyl-L-lysine, Q312205, [Glycine-cleavage complex H protein]-N6-lipoyl-L-lysine |
|---|---|
| Topological Polar Surface Area | 93.7 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | FCCDDURTIIUXBY-SSDOTTSWSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | E.C. 3.2.1.17, E1105, Muramidase, N-Acetylmuramylhydrolase, Peptidoglycan N-acetylmuramoylhydrolase |
| Heavy Atom Count | 12.0 |
| Compound Name | (R)-lipoamide |
| Description | Preservative. Prevents late blowing in semi-hard cheeses due to Clostridium tyrobutyricum Lysozyme is part of the innate immune system. Children fed infant formula lack lysozyme in their diet and have three times the rate of diarrheal disease.[citation needed] Since lysozyme is a natural form of protection from pathogens like Salmonella, E.coli and Pseudomonas, when it is deficient due to infant formula feeding, can lead to increased incidence of disease., Whereas the skin is a protective barrier due to its dryness and acidity, the conjunctiva (membrane covering the eye) is instead protected by secreted enzymes, mainly lysozyme and defensin. However, when these protective barriers fail, conjunctivitis results. Lysozyme is found in garden onion, papaya, and soft-necked garlic. |
| Exact Mass | 205.06 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 205.06 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 152.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 205.3 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | 5-[(3R)-dithiolan-3-yl]pentanamide |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10)/t7-/m1/s1 |
| Smiles | C1CSS[C@@H]1CCCCC(=O)N |
| Xlogp | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C8H15NOS2 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Carica Papaya (Plant) Rel Props:Source_db:fooddb_chem_all