10-Methylacridin-9(10H)-one
PubChem CID: 69751
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 10-Methyl-9(10H)-acridone, 719-54-0, 10-Methylacridin-9(10H)-one, N-Methylacridone, 10-methylacridin-9-one, 9(10H)-Acridinone, 10-methyl-, 10-Methyl-9-acridanone, N-Methyl-9-acridone, 9-Acridanone, 10-methyl-, 10-methylacridone, 10-Methyl-9(10H)-acridinone, 10-Methylacridon, N-Methyl-acridone, NSC-1189, NSC-54142, 10-methyl-9,10-dihydroacridin-9-one, NSC 1189, EINECS 211-948-1, MFCD00005024, NSC 54142, ST067105, SCHEMBL53107, T3C3AS93E3, 10-Methyl-9-acridanone, 8CI, CHEMBL1288901, 10-Methyl-10H-acridin-9-one, DTXSID50222159, NSC1189, 9-Hydro-l0-methyl-9-oxoacridine, CHEBI:177529, 10-Methyl-9(10H)-acridinone #, NSC54142, 9-Acridanone, 10-methyl- (8CI), STK376612, AKOS001599123, 10-Methyl-9(10H)-acridinone, 9CI, 10-Methyl-9(10H)-acridone, 99%, NCGC00183820-01, AS-49427, RD7-5039, 9(10H)-Acridinone, 10-methyl- (9CI), CS-0151123, M0792, NS00037305, I10197, SR-01000412797, SR-01000412797-1, Q15632877, InChI=1/C14H11NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-9H,1H |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1C2CCCCC2CC2CCCCC21 |
| Np Classifier Class | Acridone alkaloids |
| Deep Smiles | Cncccccc6c=O)cc%10cccc6 |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Quinolines and derivatives |
| Description | Constituent of the roots of Citrus deliciosa (Italian tangerine). 10-Methylacridone is found in citrus. |
| Scaffold Graph Node Level | OC1C2CCCCC2NC2CCCCC21 |
| Classyfire Subclass | Benzoquinolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 262.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 10-methylacridin-9-one |
| Class | Quinolines and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.1 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Benzoquinolines |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H11NO |
| Scaffold Graph Node Bond Level | O=c1c2ccccc2[nH]c2ccccc12 |
| Inchi Key | XUVKSPPGPPFPQN-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Synonyms | 10-Methyl-9-acridanone, 10-Methyl-9-acridanone, 8CI, 10-Methyl-9(10H)-acridinone, 10-Methyl-9(10H)-acridinone, 9CI, 10-Methyl-9(10H)-acridone, 10-Methylacridin-9(10H)-one, 10-Methylacridon, 9-Acridanone, 10-methyl-, 9-Acridanone, 10-methyl- (8CI), 9(10H)-Acridinone, 10-methyl-, 9(10H)-Acridinone, 10-methyl- (9CI), N-Methyl-9-acridone, N-methyl-acridone, N-Methylacridone, 10-Methyl-9(10H)-acridinone, 9ci, 10-Methyl-9-acridanone, 8ci, 9(10H)-Acridinone, 10-methyl- (9ci), 9-Acridanone, 10-methyl- (8ci), N-Methyl-acridone, n-methylacridone |
| Esol Class | Soluble |
| Functional Groups | c=O, cn(c)C |
| Compound Name | 10-Methylacridin-9(10H)-one |
| Kingdom | Organic compounds |
| Exact Mass | 209.084 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 209.084 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 209.24 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C14H11NO/c1-15-12-8-4-2-6-10(12)14(16)11-7-3-5-9-13(11)15/h2-9H,1H3 |
| Smiles | CN1C2=CC=CC=C2C(=O)C3=CC=CC=C31 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Acridones |
| Np Classifier Superclass | Anthranilic acid alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Vepris Bilocularis (Plant) Rel Props:Reference:ISBN:9780387706375