Norisodomesticine
PubChem CID: 69406100
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Norisodomesticine, Norjuzipjine, SCHEMBL5325477, 2-Hydroxy-1-methoxy-9,10-methylenedioxynoraporphine |
|---|---|
| Topological Polar Surface Area | 60.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | GUVKEPNWVHYXGH-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Substituent Name | Aporphine, Benzylisoquinoline, Phenanthrene, Benzoquinoline, 2-naphthol, Tetrahydroisoquinoline, Quinoline, Naphthalene, Methoxyphenol, Benzodioxole, Anisole, Aralkylamine, Alkyl aryl ether, Benzenoid, Oxacycle, Azacycle, Organoheterocyclic compound, Secondary amine, Ether, Secondary aliphatic amine, Acetal, Hydrocarbon derivative, Organooxygen compound, Organonitrogen compound, Amine, Aromatic heteropolycyclic compound |
| Synonyms | 2-Hydroxy-1-methoxy-9,10-methylenedioxynoraporphine, Norisodomesticine, Norjuzipjine |
| Heavy Atom Count | 23.0 |
| Compound Name | Norisodomesticine |
| Kingdom | Organic compounds |
| Description | Alkaloid from the leaves Laurus nobilis (bay laurel). Norisodomesticine is found in tea, sweet bay, and herbs and spices. |
| Exact Mass | 311.116 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 311.116 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 460.0 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 311.3 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 19-methoxy-5,7-dioxa-13-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(20),2,4(8),9,16,18-hexaen-18-ol |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Class | Aporphines |
| Inchi | InChI=1S/C18H17NO4/c1-21-18-13(20)5-9-2-3-19-12-4-10-6-14-15(23-8-22-14)7-11(10)17(18)16(9)12/h5-7,12,19-20H,2-4,8H2,1H3 |
| Smiles | COC1=C(C=C2CCNC3C2=C1C4=CC5=C(C=C4C3)OCO5)O |
| Xlogp | 2.4 |
| Superclass | Alkaloids and derivatives |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Aporphines |
| Molecular Formula | C18H17NO4 |
- 1. Outgoing r'ship
FOUND_INto/from Laurus Nobilis (Plant) Rel Props:Source_db:fooddb_chem_all