L-Proline, 4-hydroxy-, cis-
PubChem CID: 69248
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | (2S)-4-hydroxypyrrolidine-2-carboxylic acid, 4-Hydroxy-L-proline, 4-hydroxyproline, 6912-67-0, The (R)-4-hydroxy L-isomer has been assumedunless otherwise specified or implied in the original document and is indexed at L-Proline,4-hydroxy-,(4R)- [51-35-4]. When synthetichydroxyproline has been clearly indicated in theoriginal document,the 4-hydroxy, Proline, 4-hydroxy-, L-Proline, 4-hydroxy-, cis-, cis-Hydroxyproline, L-Allohydroxyproline, allo-L-Hydroxyproline, 1599456-27-5, 4 HYDROXYPROLINE, L-Proline, allo-hydroxy-, CHEBI:18240, 4-Hydroxy-proline, 4hydroxy-l-proline, (2S)-4-hydroxy-2-pyrrolidinecarboxylic acid, cis-4-hydroxy-l-pro, 4-Hydroxy-(L)-proline, 4-cis-Hydroxy-L-proline, SCHEMBL21184, 4-Hydroxy-L-proline, (Z)-, L-Proline, allo-hydroxy-, cis, cis-Proline, 4-allo-hydroxy-, L-, L-Proline, 4-hydroxy-, cis-(9CI), AS-10781, CS-0526696, H0296, EN300-52628, Q27102938 |
|---|---|
| Topological Polar Surface Area | 69.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 9.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 125.0 |
| Database Name | cmaup_ingredients;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-4-hydroxypyrrolidine-2-carboxylic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Xlogp | -3.3 |
| Is Pains | False |
| Molecular Formula | C5H9NO3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PMMYEEVYMWASQN-BKLSDQPFSA-N |
| Fcsp3 | 0.8 |
| Logs | -0.143 |
| Rotatable Bond Count | 1.0 |
| Logd | -1.335 |
| Compound Name | L-Proline, 4-hydroxy-, cis- |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 131.058 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 131.058 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 131.13 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | 1.4100878000000001 |
| Inchi | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3?,4-/m0/s1 |
| Smiles | C1[C@H](NCC1O)C(=O)O |
| Nring | 1.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Santalum Album (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all