2-(Dimethylamino)benzoic acid
PubChem CID: 69118
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-(Dimethylamino)benzoic acid, 610-16-2, 2-Dimethylaminobenzoic acid, N,N-Dimethylanthranilic acid, Benzoic acid, 2-(dimethylamino)-, Anthranilic acid, N,N-dimethyl-, GOK1CXE62K, o-DIMETHYLAMINOBENZOIC ACID, 2-(N,N-Dimethylamino)benzoic acid, EINECS 210-209-0, MFCD00016496, NSC 45790, NSC-45790, AI3-05925, DTXSID4060577, UNII-GOK1CXE62K, 2-Dimethylaminobenzoicacid, Anthranilic acid,N-dimethyl-, SCHEMBL15240, N,N-dimethylaminobenzoic acid, benzoic acid, 2-dimethylamino-, CHEMBL3098155, DTXCID8042923, NSC45790, 2-Aminobenzoic acid, N,N-dimethyl-, AKOS000260519, CS-W010823, FD70720, SB75749, VS-0341, Anthranilic acid, N,N-dimethyl-(8CI), 2-Dimethylamino-benzoic acid, hydrochloride, DB-053768, D5463, NS00034525, EN300-58586, 210-209-0 |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | DVVXXHVHGGWWPE-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | N,N-Dimethylanthranilate, N,N-Dimethylanthranilic acid |
| Heavy Atom Count | 12.0 |
| Compound Name | 2-(Dimethylamino)benzoic acid |
| Description | N,n-dimethylanthranilic acid is a member of the class of compounds known as aminobenzoic acids. Aminobenzoic acids are benzoic acids containing an amine group attached to the benzene moiety. N,n-dimethylanthranilic acid is soluble (in water) and a weakly acidic compound (based on its pKa). N,n-dimethylanthranilic acid can be found in fig, which makes n,n-dimethylanthranilic acid a potential biomarker for the consumption of this food product. |
| Exact Mass | 165.079 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 165.079 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 168.0 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 165.19 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(dimethylamino)benzoic acid |
| Total Atom Stereocenter Count | 0.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12) |
| Smiles | CN(C)C1=CC=CC=C1C(=O)O |
| Xlogp | 1.7 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C9H11NO2 |
- 1. Outgoing r'ship
FOUND_INto/from Ficus Carica (Plant) Rel Props:Source_db:fooddb_chem_all