Stigmastane
PubChem CID: 6857438
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Stigmastane, Stigmastan, .alpha.-Stigmastane, 601-58-1, (24R)-5.alpha.-Stigmastane, CHEBI:26773, DTXSID30425883, Cholestane, 24-ethyl-, (24R)-, 5.alpha.-Stigmastane, 1H-Cyclopenta[a]phenanthrene, 17-(4-ethyl-1,5-dimethylhexyl)hexadecahydro-10,13-dimethyl-, [8R-[8.alpha.,9.beta.,10.alpha.,13.alpha.,14.beta.,17.alpha.(1R*,4R*)]]-, alpha-Stigmastane, (24R)-5alpha-Stigmastane, DTXCID00376717, LMST01040264, (8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene, NS00076598, C19666, Q27109917, 1H-Cyclopenta(a)phenanthrene, 17-(4-ethyl-1,5-dimethylhexyl)hexadecahydro-10,13-dimethyl-, (8R-(8alpha,9beta,10alpha,13alpha,14beta,17alpha(1R*,4R*)))- |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Np Classifier Class | Stigmastane steroids |
| Deep Smiles | CC[C@@H]CC)C))CC[C@H][C@H]CC[C@@H][C@]5C)CC[C@H][C@H]6CCC[C@]6C)CCCC6)))))))))))))))))C |
| Heavy Atom Count | 29.0 |
| Classyfire Class | Steroids and steroid derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Classyfire Subclass | Stigmastanes and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 548.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 8.0 |
| Iupac Name | (8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 11.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C29H52 |
| Scaffold Graph Node Bond Level | C1CCC2C(C1)CCC1C3CCCC3CCC21 |
| Inchi Key | GKBHKNPLNHLYHT-LWQAOISPSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 6.0 |
| Synonyms | stigmastan, stigmastane |
| Esol Class | Poorly soluble |
| Compound Name | Stigmastane |
| Exact Mass | 400.407 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 400.407 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 400.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C29H52/c1-7-22(20(2)3)12-11-21(4)25-15-16-26-24-14-13-23-10-8-9-18-28(23,5)27(24)17-19-29(25,26)6/h20-27H,7-19H2,1-6H3/t21-,22-,23?,24+,25-,26+,27+,28+,29-/m1/s1 |
| Smiles | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@]3(CCCC4)C)C)C(C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Steroids |
- 1. Outgoing r'ship
FOUND_INto/from Abroma Radix (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Actiniopteris Radiata (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.764185 - 3. Outgoing r'ship
FOUND_INto/from Atista Radix (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Codonopsis Radix (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Echinopsis Radix (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Hemerocallis Radix (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Pistia Stratiotes (Plant) Rel Props:Reference:ISBN:9788172362461