2,4'-Dipyridyl
PubChem CID: 68488
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,4'-Bipyridine, 581-47-5, 2,4'-Dipyridyl, 2,4'-Bipyridyl, 4-Pyridylpyridine, 2,4-Bipyridine, 2,4-Bipyridyl, 2-pyridin-4-ylpyridine, 2,4'-Dipyridine, CCRIS 3428, EINECS 209-467-7, UNII-C6SN6RU851, MFCD00006217, C6SN6RU851, DTXSID40206822, 2,4'Dipyridine, 2,4'Dipyridyl, 2-pyridin-4-ylpyridin, 4-(2-pyridyl)pyridine, 2-(pyridin-4-yl)pyridine, pyridine, 2-(4-pyridyl)-, MLS002206293, SCHEMBL169510, CHEMBL1867574, DTXCID70129313, HMS2199F20, AKOS007930389, CS-W018006, NCGC00247407-01, BS-17678, SMR001295111, SY055305, 2,4 inverted exclamation mark -Bipyridine, DB-053159, B0863, NS00042951, EN300-114798, H10932, Q209228 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 25.8 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC(C2CCCCC2)CC1 |
| Np Classifier Class | Pyridine alkaloids |
| Deep Smiles | nccccc6))cccccn6 |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Pyridines and derivatives |
| Scaffold Graph Node Level | C1CCC(C2CCNCC2)NC1 |
| Classyfire Subclass | Bipyridines and oligopyridines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 130.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-pyridin-4-ylpyridine |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 1.6 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H8N2 |
| Scaffold Graph Node Bond Level | c1ccc(-c2ccncc2)nc1 |
| Inchi Key | RMHQDKYZXJVCME-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | 2,4'-dipyridyl |
| Esol Class | Soluble |
| Functional Groups | cnc |
| Compound Name | 2,4'-Dipyridyl |
| Exact Mass | 156.069 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 156.069 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 156.18 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H8N2/c1-2-6-12-10(3-1)9-4-7-11-8-5-9/h1-8H |
| Smiles | C1=CC=NC(=C1)C2=CC=NC=C2 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Nicotinic acid alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Nicotiana Tabacum (Plant) Rel Props:Reference:ISBN:9788185042138