Flindersine
PubChem CID: 68230
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Flindersine, 523-64-8, 2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one, 6A8PD12CKP, ST044783, CHEBI:5094, 2,2-dimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinolin-5-one, NSC-94655, 2,2-Dimethyl-2,6-dihydro-pyrano[3,2-c]quinolin-5-one, 2h-pyrano[3,2-c]quinolin-5-ol, 2,2-dimethyl-, UNII-6A8PD12CKP, NSC 94655, starbld0041951, FLINDERSINE [MI], Oprea1_017316, Oprea1_138192, MLS000071803, SCHEMBL3125149, 2,2-dimethyl-6-hydro-2H-pyrano[5,6-c]quinolin-5-one, CHEMBL1507844, PXNMNABLQWUMCX-UHFFFAOYSA-, DTXSID80200324, PXNMNABLQWUMCX-UHFFFAOYSA-N, HMS1648O08, HMS2303K10, NSC94655, STK722191, AKOS000635152, FF157195, SMR000009047, 5H-Pyrano[3, 2,6-dihydro-2,2-dimethyl-, Q5862594, F0722-8699, 2,2-DIMETHYL-2H,5H,6H-PYRANO[3,2-C]QUINOLIN-5-ONE, 2,6-Dihydro-2,2-dimethyl-5H-pyrano[3,2-c]-quinolin-5-one, 5H-Pyrano(3,2-c)quinolin-5-one, 2,6-dihydro-2,2-dimethyl-, 2,6-DIHYDRO-2,2-DIMETHYL-5H-PYRANO(3,2-C)QUINOLIN-5-ONE, 2,2'-DIMETHYL-.ALPHA.-PYRANO(5',6',3,4)-2(1H)-QUINOLONE, InChI=1/C14H13NO2/c1-14(2)8-7-10-12(17-14)9-5-3-4-6-11(9)15-13(10)16/h3-8H,1-2H3,(H,15,16) |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 38.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC2CCCCC2C2CCCCC12 |
| Np Classifier Class | Quinoline alkaloids |
| Deep Smiles | O=c[nH]cccccc6cc%10C=CCO6)C)C |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | OC1NC2CCCCC2C2OCCCC12 |
| Classyfire Subclass | Quinolones and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 420.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P00811, Q99714, Q9NUW8, n.a. |
| Iupac Name | 2,2-dimethyl-6H-pyrano[3,2-c]quinolin-5-one |
| Prediction Hob | 1.0 |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Target Id | NPT149 |
| Xlogp | 2.0 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H13NO2 |
| Scaffold Graph Node Bond Level | O=c1[nH]c2ccccc2c2c1C=CCO2 |
| Prediction Swissadme | 0.0 |
| Inchi Key | PXNMNABLQWUMCX-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.2142857142857142 |
| Logs | -3.072 |
| Rotatable Bond Count | 0.0 |
| Logd | 3.169 |
| Synonyms | flindersine |
| Esol Class | Soluble |
| Functional Groups | c=O, cC=CC, cOC, c[nH]c |
| Compound Name | Flindersine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 227.095 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 227.095 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 227.26 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Esol | -3.631024717647059 |
| Inchi | InChI=1S/C14H13NO2/c1-14(2)8-7-10-12(17-14)9-5-3-4-6-11(9)15-13(10)16/h3-8H,1-2H3,(H,15,16) |
| Smiles | CC1(C=CC2=C(O1)C3=CC=CC=C3NC2=O)C |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids, Anthranilic acid alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Acronychia Laurifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Agave Deserti (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Aglaia Pyramidata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Asclepias Subulata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Bistorta Manshuriensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Celastrus Monospermus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Conium Maculatum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Eutrochium Purpureum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Haplophyllum Acutifolium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Hortonia Floribunda (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Hosta Sieboldiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Inula Salsoloides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Jacobaea Cannabifolia (Plant) Rel Props:Source_db:npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Morinda Coreia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Passiflora Morifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Sarcomelicope Glauca (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Schrebera Swietenioides (Plant) Rel Props:Source_db:npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Senecio Gilliesi (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Solanum Spirale (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Sophora Leachiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Swietenia Mahagoni (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Talipariti Tiliaceum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 23. Outgoing r'ship
FOUND_INto/from Vernonia Lilacina (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 24. Outgoing r'ship
FOUND_INto/from Zanthoxylum Nitidum (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/19551734 - 25. Outgoing r'ship
FOUND_INto/from Zanthoxylum Simulans (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all