1-Terpinen-5-ol
PubChem CID: 68124095
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | p-Menth-1-en-5-ol, 1-Terpinen-5-ol, 55708-42-4, 3-Cyclohexen-1-ol, 3-methyl-6-(1-methylethyl)-, 3-methyl-6-propan-2-ylcyclohex-3-en-1-ol, 3-methyl-6-(propan-2-yl)cyclohex-3-en-1-ol, DTXSID801316907, p-Menth-1(6)-en-3-ol, SCHEMBL11756835, UDQXLNRIDGDFAR-UHFFFAOYSA-N, DTXCID101746729, 6-isopropyl-3-methyl-3-cyclohexen-1-ol, EN300-260011, 3-Methyl-6-(1-methylethyl)-3-cyclohexen-1-ol, 862-621-0 |
|---|---|
| Topological Polar Surface Area | 20.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | UDQXLNRIDGDFAR-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Substituent Name | Menthane monoterpenoid, Monocyclic monoterpenoid, Cyclic alcohol, Secondary alcohol, Hydrocarbon derivative, Organooxygen compound, Alcohol, Aliphatic homomonocyclic compound |
| Synonyms | 1-Terpinen-5-ol, 3-Methyl-6-(1-methylethyl)-3-cyclohexen-1-ol, 6-Isopropyl-3-methyl-3-cyclohexen-1-ol, p-Menth-1(6)-en-3-ol, P-Menth-1(6)-en-3-ol |
| Heavy Atom Count | 11.0 |
| Compound Name | 1-Terpinen-5-ol |
| Kingdom | Organic compounds |
| Description | Isolated from Piper nigrum (pepper). p-Menth-1-en-5-ol is found in herbs and spices, fruits, and pepper (spice). |
| Exact Mass | 154.136 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 154.136 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 158.0 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 154.25 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-methyl-6-propan-2-ylcyclohex-3-en-1-ol |
| Total Atom Stereocenter Count | 2.0 |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h4,7,9-11H,5-6H2,1-3H3 |
| Smiles | CC1=CCC(C(C1)O)C(C)C |
| Xlogp | 2.3 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Monoterpenoids |
| Taxonomy Direct Parent | Menthane monoterpenoids |
| Molecular Formula | C10H18O |
- 1. Outgoing r'ship
FOUND_INto/from Piper Nigrum (Plant) Rel Props:Source_db:fooddb_chem_all