Isobergapten
PubChem CID: 68082
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Isobergapten, 482-48-4, Isobergaptene, 5-Methoxyangelicin, 5-Methoxy-2H-furo[2,3-H]chromen-2-one, 5-methoxyfuro[2,3-h]chromen-2-one, UNII-27X3V737WH, 2H-Furo[2,3-h]-1-benzopyran-2-one, 5-methoxy-, ISO-BERGAPTEN, 27X3V737WH, 2H-Furo(2,3-h)-1-benzopyran-2-one, 5-methoxy-, DTXSID8075415, CHEBI:81487, 5-Methoxy-2H-furo(2,3-h)-1-benzopyran-2-one, 5-Methoxyangelicin, Isobergaptene, 5-BENZOFURANACRYLIC ACID, 4-HYDROXY-6-METHOXY-, .DELTA.-LACTONE, 5-Methoxy-2H-furo(2,3-H)chromen-2-one, SPBio_000306, 5-methoxy-angelicin, MFCD00016756, Spectrum_000630, Isobergapten (Standard), SpecPlus_000152, Spectrum2_000313, Spectrum3_001226, Spectrum4_001445, Spectrum5_000029, BSPBio_002672, KBioGR_001929, KBioSS_001110, SPECTRUM300032, MLS000574855, DivK1c_006248, CHEMBL141690, MEGxp0_000707, SCHEMBL2253427, DTXCID6040612, HY-N0764R, KBio1_001192, KBio2_001110, KBio2_003678, KBio2_006246, KBio3_002172, HMS2201F13, HMS3330D17, HY-N0764, CCG-38589, s9557, AKOS000277832, FI42764, SDCCGMLS-0066519.P001, NCGC00095572-01, NCGC00095572-02, NCGC00095572-03, NCGC00178537-01, AC-34979, MS-23185, SMR000156214, DB-051536, CS-0009791, NS00094826, 5-Methoxy-2H-furo[2,3-H]chromen-2-one #, C18082, SR-01000721827, SR-01000721827-2, BRD-K31678817-001-02-0, BRD-K31678817-001-06-1, Q27155416, 5-BENZOFURANACRYLIC ACID, 4-HYDROXY-6-METHOXY-, DELTA-LACTONE |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 48.7 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCC3CCCC3C2C1 |
| Np Classifier Class | Furocoumarins |
| Deep Smiles | COcccoccc5cc9ccc=O)o6 |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Coumarins and derivatives |
| Description | Isobergapten is a member of the class of compounds known as angular furanocoumarins. Angular furanocoumarins are furanocoumarins, with a structure characterized by a furan ring angularly fused to a coumarin. Isobergapten is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Isobergapten can be found in parsnip, which makes isobergapten a potential biomarker for the consumption of this food product. Isobergapten is a non-carcinogenic (not listed by IARC) potentially toxic compound. Furocoumarin toxins can cause stomach ache and may also cause a painful skin reaction when contact with the parsnip plant is combined with UV rays from sunlight (L579) (T3DB). |
| Scaffold Graph Node Level | OC1CCC2CCC3OCCC3C2O1 |
| Classyfire Subclass | Furanocoumarins |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 325.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | B2RXH2, P00352, P10636, P08684, Q96KQ7, O94782, O75874, O75496, Q9NPD5, Q9Y6L6, n.a. |
| Iupac Name | 5-methoxyfuro[2,3-h]chromen-2-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Coumarins and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Target Id | NPT48, NPT94, NPT51, NPT109 |
| Xlogp | 2.0 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Furanocoumarins |
| Gsk 4 400 Rule | True |
| Molecular Formula | C12H8O4 |
| Scaffold Graph Node Bond Level | O=c1ccc2ccc3occc3c2o1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | AJSPSRWWZBBIOR-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.0833333333333333 |
| Logs | -3.681 |
| Rotatable Bond Count | 1.0 |
| Logd | 2.483 |
| Synonyms | 2H-Furo(2,3-h)-1-benzopyran-2-one, 5-methoxy-, 2H-Furo[2,3-h]-1-benzopyran-2-one, 5-methoxy-, 5-Methoxy-2H-furo(2,3-h)-1-benzopyran-2-one, 5-Methoxy-2H-furo[2,3-H]chromen-2-one, 5-Methoxyangelicin, Isobergapten, Isobergaptene, isobergapten, isobergaptene |
| Esol Class | Soluble |
| Functional Groups | c=O, cOC, coc |
| Compound Name | Isobergapten |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 216.042 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 216.042 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 216.19 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.0873403999999995 |
| Inchi | InChI=1S/C12H8O4/c1-14-9-6-10-8(4-5-15-10)12-7(9)2-3-11(13)16-12/h2-6H,1H3 |
| Smiles | COC1=C2C=CC(=O)OC2=C3C=COC3=C1 |
| Nring | 3.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Angular furanocoumarins |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Acanthus Montanus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Angelica Archangelica (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1993.9698257 - 3. Outgoing r'ship
FOUND_INto/from Angelica Pubescens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Antidesma Membranaceum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Citrus Maxima (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1999.9701228 - 6. Outgoing r'ship
FOUND_INto/from Garcinia Parvifolia (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Hansenia Weberbaueriana (Plant) Rel Props:Source_db:cmaup_ingredients - 8. Outgoing r'ship
FOUND_INto/from Heracleum Candicans (Plant) Rel Props:Reference:ISBN:9788185042114 - 9. Outgoing r'ship
FOUND_INto/from Heracleum Canescens (Plant) Rel Props:Reference:ISBN:9788172362300; ISBN:9788185042138 - 10. Outgoing r'ship
FOUND_INto/from Heracleum Lanatum (Plant) Rel Props:Reference:ISBN:9788185042114 - 11. Outgoing r'ship
FOUND_INto/from Heracleum Maximum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Heracleum Nepalense (Plant) Rel Props:Reference:ISBN:9788185042114 - 13. Outgoing r'ship
FOUND_INto/from Heracleum Wallichii (Plant) Rel Props:Reference:ISBN:9788185042084 - 14. Outgoing r'ship
FOUND_INto/from Heracleum Yungningense (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Hernandia Guianensis (Plant) Rel Props:Reference:ISBN:9788185042138 - 16. Outgoing r'ship
FOUND_INto/from Hernandia Nymphaeifolia (Plant) Rel Props:Reference:ISBN:9788185042138 - 17. Outgoing r'ship
FOUND_INto/from Kniphofia Tuckii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 18. Outgoing r'ship
FOUND_INto/from Pastinaca Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 19. Outgoing r'ship
FOUND_INto/from Patrinia Villosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Pimpinella Magna (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 21. Outgoing r'ship
FOUND_INto/from Pimpinella Saxifraga (Plant) Rel Props:Source_db:npass_chem_all - 22. Outgoing r'ship
FOUND_INto/from Pinda Concanensis (Plant) Rel Props:Reference:ISBN:9788185042138 - 23. Outgoing r'ship
FOUND_INto/from Pinus Krempfii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 24. Outgoing r'ship
FOUND_INto/from Quercus Sessilis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 25. Outgoing r'ship
FOUND_INto/from Ruta Pinnata (Plant) Rel Props:Source_db:npass_chem_all - 26. Outgoing r'ship
FOUND_INto/from Saposhnikovia Divaricata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 27. Outgoing r'ship
FOUND_INto/from Schenkia Spicata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 28. Outgoing r'ship
FOUND_INto/from Seseli Libanotis (Plant) Rel Props:Reference:ISBN:9788185042084 - 29. Outgoing r'ship
FOUND_INto/from Stellera Chamaejasme (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 30. Outgoing r'ship
FOUND_INto/from Trixis Inula (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 31. Outgoing r'ship
FOUND_INto/from Zanthoxylum Echinocarpum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all