Skatole
PubChem CID: 6736
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 3-METHYLINDOLE, 3-Methyl-1H-indole, Skatole, 83-34-1, Scatole, Skatol, 1H-Indole, 3-methyl-, beta-Methylindole, Indole, 3-methyl-, 3-MI, 3-methyl indole, 3-Methyl-4,5-benzopyrrole, FEMA No. 3019, CCRIS 8961, NSC 122024, HSDB 3511, EINECS 201-471-7, MFCD00005627, .beta.-Methylindole, UNII-9W945B5H7R, SKATOLUM, CHEBI:9171, DTXSID8021775, AI3-24372, 9W945B5H7R, NSC-122024, DTXCID601775, 3-methylindole (skatole), NCGC00167540-01, 16alpha-Hydroxycortisol, Skatole, >=98%, 3 Methylindole, CAS-83-34-1, SMR000677925, b-Methylindole, 3-methyl-indole, U 34908, 16a,17-Dihydroxy-corticosterone, 11ss,16a,17,21-Tetrahydroxy-pregn-4-ene-3,20-dione, 11ss,16a,17,21-Tetrahydroxypregn-4-ene-3,20-dione, Skatole (Standard), 3-methyl-1H-indol, SKATOLUM [HPUS], 3-Methylindole, 98%, SKATOLE [FHFI], SKATOLE [MI], bmse000516, SCHEMBL5396, MLS001332537, MLS001332538, WLN: T56 BMJ D1, 3-METHYLINDOLE [HSDB], CHEMBL1329793, HMS2233B05, HMS3371O13, 3-Methylindole, analytical standard, BCP00912, HY-W007355R, Tox21_112537, NSC122024, s4959, STK033388, AKOS005254880, Tox21_112537_1, CCG-214598, CG-0502, CS-W007355, FM10897, HY-W007355, SB14956, NCGC00167540-03, AC-13010, DB-011225, M0347, NS00013192, EN300-41009, C08313, P10013, SBI-0633474.0002, AP-065/40182778, Q412281, BRD-K73824630-001-03-2, Z415653134, InChI=1/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H, 201-471-7 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 15.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CCCC2C1 |
| Np Classifier Class | Simple indole alkaloids |
| Deep Smiles | Ccc[nH]cc5cccc6 |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Indoles and derivatives |
| Description | 3-methylindole, also known as skatol or 3-methyl-4,5-benzopyrrole, is a member of the class of compounds known as 3-methylindoles. 3-methylindoles are aromatic heterocyclic compounds that contain an indole moiety substituted at the 3-position with a methyl group. 3-methylindole is slightly soluble (in water) and an extremely weak acidic compound (based on its pKa). 3-methylindole is a very strong, animal, and civet tasting compound found in common beet and red beetroot, which makes 3-methylindole a potential biomarker for the consumption of these food products. 3-methylindole can be found primarily in feces and saliva. Skatole or 3-methylindole is a mildly toxic white crystalline organic compound belonging to the indole family. It occurs naturally in feces (it is produced from tryptophan in the mammalian digestive tract) and coal tar and has a strong fecal odor. In low concentrations, it has a flowery smell and is found in several flowers and essential oils, including those of orange blossoms, jasmine, and Ziziphus mauritiana. It is used as a fragrance and fixative in many perfumes and as an aroma compound. Its name is derived from the Greek root skato- meaning "dung". Skatole was discovered in 1877 by the German physician Ludwig Brieger (1849–1919). Skatole is also used by U.S. military in its non-lethal weaponry, specifically, malodorants . |
| Scaffold Graph Node Level | C1CCC2NCCC2C1 |
| Classyfire Subclass | Indoles |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 122.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P24903, P00811, Q13315, O75496, Q03431, n.a. |
| Iupac Name | 3-methyl-1H-indole |
| Prediction Hob | 1.0 |
| Class | Indoles and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Target Id | NPT524 |
| Xlogp | 2.6 |
| Superclass | Organoheterocyclic compounds |
| Subclass | Indoles |
| Gsk 4 400 Rule | True |
| Molecular Formula | C9H9N |
| Scaffold Graph Node Bond Level | c1ccc2[nH]ccc2c1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | ZFRKQXVRDFCRJG-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.1111111111111111 |
| Logs | -2.407 |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Logd | 2.686 |
| Synonyms | 3-Methyl-4,5-benzopyrrole, beta-Methylindole, Skatol, b-Methylindole, Β-methylindole, 3-Methyl-1H-indole, 3-MI, Scatole, Skatole, 3 Methylindole, 3-Methylindole, 3-methylindole, skatole |
| Esol Class | Soluble |
| Functional Groups | c[nH]c |
| Compound Name | Skatole |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 131.073 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 131.073 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 131.17 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -2.7746036 |
| Inchi | InChI=1S/C9H9N/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6,10H,1H3 |
| Smiles | CC1=CNC2=CC=CC=C12 |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | 3-methylindoles |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Aphananthe Cuspidata (Plant) Rel Props:Reference:ISBN:9788172361266 - 2. Outgoing r'ship
FOUND_INto/from Beta Vulgaris (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Brassica Oleracea (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Citrus Japonica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Croomia Japonica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Eupatorium Glehni (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Gardenia Jasminoides (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Isatis Tinctoria (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2006.9699155 - 9. Outgoing r'ship
FOUND_INto/from Phyllanthus Muellerianus (Plant) Rel Props:Source_db:npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Sauromatum Venosum (Plant) Rel Props:Reference:ISBN:9788172363093 - 11. Outgoing r'ship
FOUND_INto/from Tecoma Stans (Plant) Rel Props:Reference:ISBN:9788185042138 - 12. Outgoing r'ship
FOUND_INto/from Uncaria Nervosa (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all