N-Methylformanilide
PubChem CID: 66737
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N-Methylformanilide, 93-61-8, N-Methyl-N-phenylformamide, Formamide, N-methyl-N-phenyl-, N-Formyl-N-methylaniline, Formanilide, N-methyl-, Methylphenylformamide, N-Methyl-N-formylaniline, N-Phenyl-N-methylformamide, methyl(phenyl)formamide, AI3-12081, NSC 3828, EINECS 202-262-3, DTXSID0059089, NSC-3828, N-methyl-N-phenyl-formamide, NSC3828, N-methyl formanilide, NFormylNmethylaniline, NMethylNformylaniline, Formanilide, Nmethyl, MFCD00003283, NMethylNphenylformamide, NPhenylNmethylformamide, Formamide, NmethylNphenyl, N-methyl-N-formyl-aniline, N-Methylformanilide, 99%, N-methyl-N-phenyl formamide, 3D8E5U4HSE, SCHEMBL66606, Formanilide, Nmethyl (8CI), DTXCID1048839, AKOS009157113, AS-17245, DB-002830, M0552, NS00020242, EN300-39082, Q19859377, F0001-2241, 202-262-3 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 20.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Deep Smiles | O=CNcccccc6))))))C |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Benzene and substituted derivatives |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Anilides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 108.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | N-methyl-N-phenylformamide |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 1.1 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C8H9NO |
| Scaffold Graph Node Bond Level | c1ccccc1 |
| Inchi Key | JIKUXBYRTXDNIY-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | n-methyl-n-phenylformamide |
| Esol Class | Very soluble |
| Functional Groups | cN(C)C=O |
| Compound Name | N-Methylformanilide |
| Exact Mass | 135.068 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 135.068 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 135.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C8H9NO/c1-9(7-10)8-5-3-2-4-6-8/h2-7H,1H3 |
| Smiles | CN(C=O)C1=CC=CC=C1 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Crinum Latifolium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2003.9712111