Peracetic Acid
PubChem CID: 6585
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | PERACETIC ACID, Peroxyacetic acid, Ethaneperoxoic acid, 79-21-0, Estosteril, Acetic peroxide, Peroxoacetic acid, Acetyl hydroperoxide, Monoperacetic acid, Osbon AC, Proxitane 4002, Desoxon 1, Ethaneperoxic acid, Hydroperoxide, acetyl, Acide peracetique, Acido peroxiacetico, Acecide, Proxitane, Caswell No. 644, Peroxy acetic acid, Acide peroxyacetique, Kyselina peroxyoctova, CCRIS 686, HSDB 1106, UNII-I6KPI2E1HD, I6KPI2E1HD, peroxy-acetic acid, EINECS 201-186-8, EPA Pesticide Chemical Code 063201, BRN 1098464, DTXSID1025853, CHEMBL444965, DTXCID805853, CHEBI:42530, EC 201-186-8, 4-02-00-00390 (Beilstein Handbook Reference), NCGC00166305-01, PERACETIC ACID (MART.), PERACETIC ACID [MART.], Oxypel, Perethanoic Acid, Proxitane S, Acide peracetique [French], Proxitane 12A, F50, Acide peroxyacetique [French], Acido peroxiacetico [Spanish], Kyselina peroxyoctova [Czech], Proxitane 1507, LCAP, Aceticperoxide, Ethanperoxsaure, Peressigsaure, Bactipal, Oxymaster, Soproper, acetyldioxidanyl, Dialox, peractic acid, Peroxyessigsaure, Peroxyethansaure, Sekusept steril, Acetic peroxid, per-acetic acid, Acido peracetico, Peroxacetic acid, Acid, Peracetic, Peraflu D, acetic acid oxide, TLCUO Phytoncide, peroxyethanoic acid, PU US Phytoncide, Acid, Peroxyacetic, AcOOH, Acecide (TN), Acid, Peroxyethanoic, GPES, JOYCARE, UNICARE, Wofasteril E 400, CLEAN WORKS, TLCUO LEMON, CARE PLUS, TLCUO PURE, PU US LEMON, PU US PURE, CH3CO2OH, WECLEAN C2 TLCUO, Ethaneperoxoic acid, 9CI, CH3C(O)OOH, BACTERIA ZERO PREMIUM, PERACETIC ACID [MI], PERACETIC ACID [HSDB], PERACETIC ACID [WHO-DD], DTXSID40957943, peroxyacetic acid (peracetic acid), BLOWHALE DEODORANT SENITIZER, Tox21_112402, BDBM50266095, Peroxyacetic acid, >43% and with >6% hydrogen peroxide [Forbidden], AKOS015837803, DB14556, CAS-79-21-0, USEPA/OPP Pesticide Code: 063201, NS00001663, D03467, EN300-173399, Dr.Vir Germ Peroxyacetic acid Multi-disinfectant, Q375140, Peroxyacetic acid, >43% and with >6% hydrogen peroxide, 201-186-8 |
|---|---|
| Topological Polar Surface Area | 46.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Heavy Atom Count | 5.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 40.2 |
| Database Name | cmaup_ingredients;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P18031 |
| Iupac Name | ethaneperoxoic acid |
| Prediction Hob | 1.0 |
| Target Id | NPT178 |
| Xlogp | -0.4 |
| Molecular Formula | C2H4O3 |
| Prediction Swissadme | 0.0 |
| Inchi Key | KFSLWBXXFJQRDL-UHFFFAOYSA-N |
| Fcsp3 | 0.5 |
| Logs | 0.885 |
| Rotatable Bond Count | 1.0 |
| Logd | -0.846 |
| Compound Name | Peracetic Acid |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 76.016 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 76.016 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 76.05 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -0.012416199999999988 |
| Inchi | InChI=1S/C2H4O3/c1-2(3)5-4/h4H,1H3 |
| Smiles | CC(=O)OO |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all