Methyl vinyl ketone
PubChem CID: 6570
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | METHYL VINYL KETONE, 3-Buten-2-one, 78-94-4, but-3-en-2-one, Butenone, Vinyl methyl ketone, Methylene acetone, 2-Butenone, Methylvinylketon, Acetyl ethylene, 1-Buten-3-one, Methylvinylketone, 3-Butene-2-one, Methyl ethenyl ketone, Methylvinyl ketone, 3-Butenone-2, Acetone, methylene-, Ketone, methyl vinyl, gamma-Oxo-alpha-butylene, Methyl-vinyl-cetone, 3-oxo-1-butene, but-1-en-3-one, delta(sup 3)-2-Butenone, UN1251, CCRIS 3423, HSDB 716, CHEBI:48058, methylvinylcetone, 3-Oxobutene, g-oxo-a-Butylene, NSC 4853, buten-2-one, EINECS 201-160-6, UNII-AR7642I1MP, 3-Butenen-2-one, DTXSID3025671, AI3-16048, Delta(3)-2-butenone, NSC-4853, CH2=CHCOCH3, MFCD00008777, 25038-87-3, .DELTA.3-2-BUTENONE, AR7642I1MP, DTXCID205671, Methyl vinyl ketone, stabilized, CHEMBL1600824, METHYL VINYL KETONE [MI], EC 201-160-6, .DELTA.-OXO-.ALPHA.-BUTYLENE, UN 1251, UN-1251, 3-Buten-2-one (90%) (Stabilized with <1% Hydroquinone), Methylvinylketon [German], METHYL VINYL KETONE, (STABILIZED), METHYL VINYL KETONE, [STABILIZED], Methyl-vinyl-cetone [French], 2Butenone, 3-butenone, 3Butene2one, methyl vinylketone, methyl-vinylketone, methylvinyl-ketone, 1Buten3one, 3Buten2one, 3Butenone2, but-3-enone, metyl vinyl ketone, 3-oxo-l-butene, Acetone, methylene, methly vinyl ketone, methyl-vinyl-ketone, gammaOxoalphabutylene, 1-butene-3-one, delta3-2-Butenone, 1-Propen-3-one, 3-oxo-but-1-ene, delta(sup 3)2Butenone, 3-2-BUTENONE, .gamma.-Oxo-.alpha.-butylene, Methyl vinyl ketone, stabilised, WLN: 1V1U1, DELTA-OXO-ALPHA-BUTYLENE, NSC4853, AAA07894, BCP24759, DELTA (SUP 3)-2-BUTENONE, Tox21_200363, BDBM50245462, LMFA12000018, STL299803, AKOS000120352, CAS-78-94-4, NCGC00091118-01, NCGC00091118-02, NCGC00257917-01, M0460, NS00004153, 3-Buten-2-one, purum, >=95.0% (GC), EN300-19794, C20701, F71092, Q417525, But-3-en-2-one (Stabilized with <1% Hydroquinone), Methyl vinyl ketone, stabilized [UN1251] [Poison], 3-Buten-2-one, contains 0.3-1.0% hydroquinone as stabilizer, technical grade, 90%, 3-Buten-2-one, contains 0.5% hydroquinone and 0.1% acetic acid as stabilizer, 99%, 201-160-6 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Oxygenated hydrocarbons |
| Deep Smiles | CC=O)C=C |
| Heavy Atom Count | 5.0 |
| Classyfire Class | Organooxygen compounds |
| Description | But-3-en-2-one, also known as 2-butenone or methyl vinyl ketone, is a member of the class of compounds known as enones. Enones are compounds containing the enone functional group, with the structure RC(=O)CR'. Thus, but-3-en-2-one is considered to be an oxygenated hydrocarbon lipid molecule. But-3-en-2-one is soluble (in water) and an extremely weak acidic compound (based on its pKa). But-3-en-2-one can be found in a number of food items such as kai-lan, roman camomile, black chokeberry, and orange mint, which makes but-3-en-2-one a potential biomarker for the consumption of these food products. But-3-en-2-one can be found primarily in saliva. |
| Classyfire Subclass | Carbonyl compounds |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 54.7 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P00352, P23977 |
| Iupac Name | but-3-en-2-one |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Class | Organooxygen compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Target Id | NPT94 |
| Xlogp | 0.5 |
| Superclass | Organic oxygen compounds |
| Is Pains | False |
| Subclass | Carbonyl compounds |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H6O |
| Prediction Swissadme | 0.0 |
| Inchi Key | FUSUHKVFWTUUBE-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.25 |
| Logs | 0.529 |
| Rotatable Bond Count | 1.0 |
| Logd | 0.355 |
| Synonyms | «, delta», 3-2-Butenone, «, gamma», -oxo-&alpha, -butylene, 1-Buten-3-one, 1-Propen-3-one, 2-Butenone, 3-Buten-2-one, 3-Butene-2-one, 3-Butenen-2-one, 3-butenone-2, 3-Oxobutene, Acetone, methylene-, Acetyl ethylene, buten-2-one, Butenone, Delta(3)-2-butenone, delta(sup 3)-2-Butenone, Gamma-oxo-alpha-butylene, Ketone, methyl vinyl, Methyl ethenyl ketone, Methyl vinyl ketone, Methyl-vinyl-cetone, Methylene acetone, Methylvinyl ketone, Methylvinylcetone, Methylvinylketon, Methylvinylketone, Poly(vinyl methyl ketone), Vinyl methyl ketone, 3-Butenone-2, But-3-en-2-one, CH2=chcoch3, Delta(3)-2-Butenone, gamma-oxo-alpha-Butylene, Δ(3)-2-butenone, g-oxo-a-Butylene, Γ-oxo-α-butylene, 1-buten-3-one, 3-buten-2-one, but-3-en-2-one, methyl vinyl ketone, methylvinylketone |
| Esol Class | Very soluble |
| Functional Groups | C=CC(C)=O |
| Compound Name | Methyl vinyl ketone |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 70.0419 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 70.0419 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 70.09 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -0.5487641999999999 |
| Inchi | InChI=1S/C4H6O/c1-3-4(2)5/h3H,1H2,2H3 |
| Smiles | CC(=O)C=C |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Enones |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Artemisia Argyi (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Artemisia Montana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Artemisia Princeps (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Cinnamomum Camphora (Plant) Rel Props:Reference:ISBN:9788172363130 - 5. Outgoing r'ship
FOUND_INto/from Cinnamomum Verum (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Dimocarpus Longan (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(199607)11:4<223::aid-ffj579>3.0.co;2-b - 7. Outgoing r'ship
FOUND_INto/from Hedychium Coronarium (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1993.9698190 - 8. Outgoing r'ship
FOUND_INto/from Juglans Regia (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1477 - 9. Outgoing r'ship
FOUND_INto/from Litsea Glutinosa (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1996.9700687 - 10. Outgoing r'ship
FOUND_INto/from Malus Domestica (Plant) Rel Props:Source_db:fooddb_chem_all - 11. Outgoing r'ship
FOUND_INto/from Sambucus Nigra (Plant) Rel Props:Source_db:fooddb_chem_all - 12. Outgoing r'ship
FOUND_INto/from Stevia Rebaudiana (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.3298 - 13. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2007.9699245 - 14. Outgoing r'ship
FOUND_INto/from Zanthoxylum Bungeanum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Zanthoxylum Piperitum (Plant) Rel Props:Source_db:npass_chem_all - 16. Outgoing r'ship
FOUND_INto/from Zanthoxylum Schinifolium (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 17. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1996.9700625