Isobutyraldehyde
PubChem CID: 6561
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | ISOBUTYRALDEHYDE, 2-Methylpropanal, 78-84-2, Isobutanal, 2-Methylpropionaldehyde, Isobutylaldehyde, Propanal, 2-methyl-, Isobutyric aldehyde, Valine aldehyde, 2-Methyl-1-propanal, Isopropylaldehyde, Isopropylformaldehyde, Isobutaldehyde, Isobutyraldehyd, Methylpropanal, Isobutyral, Methyl propanal, Isobutyryl aldehyde, Isopropyl aldehyde, alpha-Methylpropionaldehyde, Isopropyl formaldehyde, isobutyl aldehyde, Propionaldehyde, 2-methyl-, ISO-BUTYRALDEHYDE, FEMA No. 2220, Isobutyraldehyde (natural), NCI-C60968, NSC 6739, CCRIS 1101, HSDB 614, EINECS 201-149-6, .alpha.-Methylpropionaldehyde, UNII-C42E28168L, CHEBI:48943, iso-C3H7CHO, AI3-15311, 2-methyl-propionaldehyde, NSC-6739, 2-METHYL-PROPANAL, C42E28168L, ISOPROPYLCARBOXALDEHYDE, DTXSID9021635, EC 201-149-6, Isobutyraldehyde, 98%, ISOBUTYRALDEHYDE (USP-RS), ISOBUTYRALDEHYDE [USP-RS], Isobutyraldehyd [Czech], isobutyl aldehy de, Butyric iso aldehyde, MFCD00006980, UN2045, isobutyraldehye, i-butyraldehyde, iso-butanal, i-butanal, 2-methypropanal, so-Butyl aldehyde, iso-butyl aldehyde, dimethylacetaldehyde, 2-FORMYLPROPANE, 2-methyl-propan-1-one, Isobutyraldehyde, >=99%, alpha -methylpropionaldehyde, Isobutyraldehyde, redistilled, ISOBUTYRALDEHYDE [MI], Isobutyraldehyde, dry, 98%, 2-methylpropanal (isobutanal), ISOBUTYRALDEHYDE [FCC], WLN: VHY1&1, ISOBUTYRALDEHYDE [FHFI], ISOBUTYRALDEHYDE [HSDB], DTXCID201635, CHEMBL1404017, Isobutyraldehyde, >=98%, FG, FEMA 2220, Isobutyraldehyde 2-Methylpropanal, Isobutyraldehyde, >=98%, FCC, NSC6739, AAA07884, Isobutyraldehyde or isobutyl aldehyde, Isobutyraldehyde, analytical standard, Tox21_200024, BBL034648, STL264210, Isobutyraldehyde, natural, 96%, FG, AKOS000119887, UN 2045, CAS-78-84-2, NCGC00091788-01, NCGC00091788-02, NCGC00257578-01, BP-20619, Isobutyraldehyde, redistilled, >=99.5%, I0101, NS00004602, EN300-19563, C22919, A839508, Q418164, InChI=1/C4H8O/c1-4(2)3-5/h3-4H,1-2H, F2190-0633, Isobutyraldehyde or isobutyl aldehyde [UN2045] [Flammable liquid], 201-149-6 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 17.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Fatty aldehydes |
| Deep Smiles | O=CCC)C |
| Heavy Atom Count | 5.0 |
| Classyfire Class | Organooxygen compounds |
| Description | Found in tea, beer, sake, brandy, fresh fruits (apple, banana, cherry etc.), breads, cooked pork, and spearmint oil |
| Classyfire Subclass | Carbonyl compounds |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 30.6 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P16152, P04150 |
| Iupac Name | 2-methylpropanal |
| Nih Violation | True |
| Prediction Hob | 1.0 |
| Class | Carbonyl compounds |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | 0.8 |
| Superclass | Organooxygen compounds |
| Is Pains | False |
| Subclass | Aldehydes |
| Gsk 4 400 Rule | True |
| Molecular Formula | C4H8O |
| Prediction Swissadme | 0.0 |
| Inchi Key | AMIMRNSIRUDHCM-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.75 |
| Logs | 0.092 |
| Rotatable Bond Count | 1.0 |
| State | Liquid |
| Logd | 0.612 |
| Synonyms | &alpha, -methylpropionaldehyde, 2-Methyl-1-propanal, 2-METHYL-PROPANAL, 2-Methyl-propionaldehyde, 2-methylpropanal (isobutanal), 2-Methylpropanal oxime, 2-Methylpropionaldehyde, a-Methylpropionaldehyde, alpha -Methylpropionaldehyde, Alpha-methylpropionaldehyde, Butyric iso aldehyde, FEMA 2220, Iso-butyraldehyde, iso-C3H7CHO, Isobutaldehyde, Isobutanal, Isobutyl aldehy de, Isobutyl aldehyde, Isobutylaldehyde, Isobutyral, Isobutyraldehyd, Isobutyraldehyde, Isobutyraldehyde oxime, Isobutyric aldehyde, Isobutyryl aldehyde, Isopropyl aldehyde, Isopropyl formaldehyde, Isopropylaldehyde, Isopropylformaldehyde, Methyl propanal, Methylpropanal, Propanal, 2-methyl-, Propionaldehyde, 2-methyl-, So-butyl aldehyde, Valine aldehyde, α-methylpropionaldehyde, alpha-Methylpropionaldehyde, Α-methylpropionaldehyde, 2-METHYL-propanal, iso-Butyraldehyde, so-Butyl aldehyde, 2-Methylpropanal, 2-methyl propanal, 2-methyl-propanal, 2-methylpropanal, isobutanal, isobutylaldehyde (2-methylpropanal), isobutyral |
| Substituent Name | Hydrocarbon derivative, Short-chain aldehyde, Aliphatic acyclic compound |
| Esol Class | Very soluble |
| Functional Groups | CC=O |
| Compound Name | Isobutyraldehyde |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 72.0575 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 72.0575 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 72.11 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -0.7061634000000001 |
| Inchi | InChI=1S/C4H8O/c1-4(2)3-5/h3-4H,1-2H3 |
| Smiles | CC(C)C=O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Short-chain aldehydes |
| Np Classifier Superclass | Fatty acyls |
- 1. Outgoing r'ship
FOUND_INto/from Acacia Aroma (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(1998070)13:4<266::aid-ffj739>3.0.co;2-5 - 2. Outgoing r'ship
FOUND_INto/from Acacia Caven (Plant) Rel Props:Reference:https://doi.org/10.1002/(sici)1099-1026(1998070)13:4<266::aid-ffj739>3.0.co;2-5 - 3. Outgoing r'ship
FOUND_INto/from Actinidia Arguta (Plant) Rel Props:Reference:https://doi.org/10.1016/s0031-9422(03)00142-0 - 4. Outgoing r'ship
FOUND_INto/from Aloe Africana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Aloe Barbadensis (Plant) Rel Props:Source_db:npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Aloe Ferox (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Aloe Spicata (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Aloe Vera (Plant) Rel Props:Source_db:cmaup_ingredients - 9. Outgoing r'ship
FOUND_INto/from Angelica Acutiloba (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Angelica Gigas (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Angelica Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 12. Outgoing r'ship
FOUND_INto/from Artemisia Argyi (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 13. Outgoing r'ship
FOUND_INto/from Artemisia Montana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 14. Outgoing r'ship
FOUND_INto/from Artemisia Princeps (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 15. Outgoing r'ship
FOUND_INto/from Callistemon Citrinus (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1998.9700935 - 16. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all - 17. Outgoing r'ship
FOUND_INto/from Capsicum Annuum (Plant) Rel Props:Source_db:fooddb_chem_all - 18. Outgoing r'ship
FOUND_INto/from Crocus Sativus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Daucus Carota (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 20. Outgoing r'ship
FOUND_INto/from Hierochloe Odorata (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060108 - 21. Outgoing r'ship
FOUND_INto/from Juglans Regia (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.1477 - 22. Outgoing r'ship
FOUND_INto/from Mentha Spicata (Plant) Rel Props:Source_db:fooddb_chem_all - 23. Outgoing r'ship
FOUND_INto/from Nicotiana Tabacum (Plant) Rel Props:Reference:ISBN:9788185042114 - 24. Outgoing r'ship
FOUND_INto/from Ocimum Basilicum (Plant) Rel Props:Reference:https://doi.org/10.1002/ffj.2730060312 - 25. Outgoing r'ship
FOUND_INto/from Origanum Vulgare (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2005.10643419 - 26. Outgoing r'ship
FOUND_INto/from Pelargonium Graveolens (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 27. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2018.1495108 - 28. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Reference:https://www.ncbi.nlm.nih.gov/pubmed/18967983 - 29. Outgoing r'ship
FOUND_INto/from Raphanus Sativus (Plant) Rel Props:Source_db:fooddb_chem_all - 30. Outgoing r'ship
FOUND_INto/from Solanum Tuberosum (Plant) Rel Props:Source_db:fooddb_chem_all - 31. Outgoing r'ship
FOUND_INto/from Ziziphus Jujuba (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.1996.9700625