(3Z)-3-[[6-[2-(dimethylamino)ethyl]-1,3-benzodioxol-5-yl]methylidene]-6,7-dimethoxyisoindol-1-one
PubChem CID: 6537302
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | True |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 69.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CC(CC2CCC3CCCC3C2)C2CCCCC12 |
| Np Classifier Class | Aporphine alkaloids |
| Deep Smiles | COccOC))cccc6C=O)N/C/5=CcccOCOc5cc9CCNC)C |
| Heavy Atom Count | 29.0 |
| Classyfire Class | Isoindoles and derivatives |
| Scaffold Graph Node Level | OC1NC(CC2CCC3OCOC3C2)C2CCCCC12 |
| Classyfire Subclass | Isoindolines |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 624.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (3Z)-3-[[6-[2-(dimethylamino)ethyl]-1,3-benzodioxol-5-yl]methylidene]-6,7-dimethoxyisoindol-1-one |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.0 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C22H24N2O5 |
| Scaffold Graph Node Bond Level | O=C1NC(=Cc2ccc3c(c2)OCO3)c2ccccc21 |
| Inchi Key | ZMAHFZSTFDAVRW-SXGWCWSVSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 6.0 |
| Synonyms | fumaridine |
| Esol Class | Moderately soluble |
| Functional Groups | CN(C)C, c/C=C1/ccC(=O)N1, c1cOCO1, cOC |
| Compound Name | (3Z)-3-[[6-[2-(dimethylamino)ethyl]-1,3-benzodioxol-5-yl]methylidene]-6,7-dimethoxyisoindol-1-one |
| Exact Mass | 396.169 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 396.169 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 396.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C22H24N2O5/c1-24(2)8-7-13-10-18-19(29-12-28-18)11-14(13)9-16-15-5-6-17(26-3)21(27-4)20(15)22(25)23-16/h5-6,9-11H,7-8,12H2,1-4H3,(H,23,25)/b16-9- |
| Smiles | CN(C)CCC1=CC2=C(C=C1/C=C\3/C4=C(C(=C(C=C4)OC)OC)C(=O)N3)OCO2 |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tyrosine alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Fumaria Indica (Plant) Rel Props:Reference:ISBN:9788172360481 - 2. Outgoing r'ship
FOUND_INto/from Fumaria Parviflora (Plant) Rel Props:Reference:ISBN:9780387706375; ISBN:9788185042053; ISBN:9788185042084; ISBN:9789327275590 - 3. Outgoing r'ship
FOUND_INto/from Fumaria Vaillantii (Plant) Rel Props:Reference:ISBN:9788172363130; ISBN:9788185042084