N-Acetylserine
PubChem CID: 65249
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N-Acetyl-L-serine, 16354-58-8, N-Acetylserine, N-Acetyl-Serine, (S)-2-Acetamido-3-hydroxypropanoic acid, L-Serine, N-acetyl-, (2S)-2-acetamido-3-hydroxypropanoic acid, acetylserine, Serine, N-acetyl-, UNII-W98518XGZ3, N-Acetyl-L-serine (>90%), CHEBI:45441, DTXSID30167615, W98518XGZ3, DL-Serine, N-acetyl-, Ac-Ser-OH, acetyl-l-serine, 2-Acetylamino-3-hydroxy-propionic acid, MFCD09952005, N-Ac-Ser-OH, SCHEMBL79542, DTXCID2090106, JJIHLJJYMXLCOY-BYPYZUCNSA-N, AKOS016846025, DB02340, FA31342, HY-134222A, (S)-2-Acetamido-3-hydroxypropionic acid, AS-46834, (2S)-2-Acetamido-3-hydroxypropionic acid, DB-320886, CS-0167102, NS00068238, EN300-200058, F10674, Q27093355, 7D1DF63F-1DD7-437D-BFD1-794C0C5610A8 |
|---|---|
| Topological Polar Surface Area | 86.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 10.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 145.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Uniprot Id | P00488 |
| Iupac Name | (2S)-2-acetamido-3-hydroxypropanoic acid |
| Prediction Hob | 1.0 |
| Class | Carboxylic acids and derivatives |
| Xlogp | -1.2 |
| Superclass | Organic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C5H9NO4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | JJIHLJJYMXLCOY-BYPYZUCNSA-N |
| Fcsp3 | 0.6 |
| Logs | -0.591 |
| Rotatable Bond Count | 3.0 |
| State | Solid |
| Logd | -1.452 |
| Synonyms | Acetylserine, N-Acetyl-L-serine, (2S)-2-Acetamido-3-hydroxypropanoic acid, (2S)-2-Acetamido-3-hydroxypropionic acid, (S)-2-Acetamido-3-hydroxypropanoic acid, (S)-2-Acetamido-3-hydroxypropionic acid, N-Acetylserine |
| Compound Name | N-Acetylserine |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 147.053 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 147.053 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 147.13 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Esol | 0.06949400000000011 |
| Inchi | InChI=1S/C5H9NO4/c1-3(8)6-4(2-7)5(9)10/h4,7H,2H2,1H3,(H,6,8)(H,9,10)/t4-/m0/s1 |
| Smiles | CC(=O)N[C@@H](CO)C(=O)O |
| Nring | 0.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | N-acyl-L-alpha-amino acids |
- 1. Outgoing r'ship
FOUND_INto/from Chlamydomonas Allensworthii (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Chlamydomonas Reinhardtii (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all