Norvaline
PubChem CID: 65098
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | L-norvaline, norvaline, 6600-40-4, (S)-2-Aminopentanoic acid, h-nva-oh, (2S)-2-aminopentanoic acid, Norvaline, L-, L-2-aminopentanoic acid, (S)-2-Aminovaleric acid, L-2-Aminovaleric acid, Norvaline (VAN), Pentanoic acid, 2-amino-, L-2-aminopentanoate, Valeric acid, 2-amino-, alpha-L-Aminopentanoic acid, A70UKS48FE, l-(+)-norvaline, CHEBI:18314, 2S-amino-pentanoic acid, NORVALINE [MI], Pentanoic acid, 2-amino-, (S)-, EINECS 229-543-3, MFCD00064421, NSC 203786, NORVALINE [WHO-DD], 2S-AMINOVALERIC ACID, (S)-(+)-2-Aminopentanoic acid, DTXSID701018015, L-.ALPHA.-AMINOVALERIC ACID, NSC-203786, S-2-aminopentanoic acid, L-(+)-2-aminovaleric acid, NVA, 2-AMINO-PENTANOIC ACID, alpha-Aminovaleric acid, (S)-2-Aminovaleric acid, a-L-Aminopentanoic acid, UNII-A70UKS48FE, L(+)-Norvaline, L-Norvaline (9CI), NORVALINE [INCI], (2S)-2-azaniumylpentanoate, SCHEMBL38405, (S)-2-amino-pentanoic acid, CHEMBL55612, L-Norvaline, arginase inhibitor, L-ALPHA-AMINOVALERIC ACID, DTXCID801476214, CS-D1371, HY-Y0399, BDBM50357215, LMFA01100041, AKOS006240270, DB04185, FN47252, AC-12879, AC-31149, AS-13576, N0686, NS00005728, NS00082367, EN300-66088, C01826, Q418707, Z1033300662, L-Nva-OH, L-2-Aminovaleric acid, (S)-2-Aminopentanoic acid, 9555A1CC-4DD7-41F1-9133-98A0F33A16A6, 229-543-3 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 63.3 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Aminoacids |
| Deep Smiles | CCC[C@@H]C=O)O))N |
| Heavy Atom Count | 8.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 82.5 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-2-aminopentanoic acid |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -2.1 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H11NO2 |
| Inchi Key | SNDPXSYFESPGGJ-BYPYZUCNSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | norvaline, valine, nor |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)O, CN |
| Compound Name | Norvaline |
| Exact Mass | 117.079 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 117.079 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 117.15 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C5H11NO2/c1-2-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| Smiles | CCC[C@@H](C(=O)O)N |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Arisaema Tortuosum (Plant) Rel Props:Reference:ISBN:9788172362140 - 2. Outgoing r'ship
FOUND_INto/from Azadirachta Indica (Plant) Rel Props:Reference:ISBN:9780896038776 - 3. Outgoing r'ship
FOUND_INto/from Caesalpinia Sappan (Plant) Rel Props:Reference:ISBN:9788171360536; ISBN:9788185042084 - 4. Outgoing r'ship
FOUND_INto/from Canavalia Gladiata (Plant) Rel Props:Reference:ISBN:9788185042138 - 5. Outgoing r'ship
FOUND_INto/from Cupressus Torulosa (Plant) Rel Props:Reference:ISBN:9788185042084 - 6. Outgoing r'ship
FOUND_INto/from Eucalyptus Globulus (Plant) Rel Props:Reference:ISBN:9788172361150