Epigallocatechin 3-O-p-coumarate
PubChem CID: 6474788
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Epigallocatechin 3-O-p-coumarate, 3-O-p-Coumaroylepigallocatechin, [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate, 89013-65-0, (-)-Epigallocatechin 3-O-p-coumaroate, ((2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl) (E)-3-(4-hydroxyphenyl)prop-2-enoate, CHEMBL345400, CHEBI:136601, Epigallocatechin 3-p-coumaric acid, (-)-Epigallocatechin 3-p-coumaroate, Epigallocatechin 3-O-p-coumaric acid, LMPK12020117, (-)-Epigallocatechin 3-p-coumaroic acid, 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl 3-(4-hydroxyphenyl)prop-2-enoate, [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chroman-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| Topological Polar Surface Area | 157.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Heavy Atom Count | 33.0 |
| Description | Isolated from leaves of green tea (Thea sinensis). Epigallocatechin 3-p-coumarate is found in tea. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 679.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Class | Flavonoids |
| Xlogp | 2.3 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | True |
| Subclass | Flavans |
| Molecular Formula | C24H20O9 |
| Prediction Swissadme | 0.0 |
| Inchi Key | HKPGWUPXXPIOAN-XMTAIGAMSA-N |
| Fcsp3 | 0.125 |
| Logs | -3.681 |
| Rotatable Bond Count | 5.0 |
| Logd | 2.367 |
| Synonyms | (-)-Epigallocatechin 3-O-p-coumaroate, (-)-Epigallocatechin 3-p-coumarate, 3-O-p-Coumaroylepigallocatechin, Epigallocatechin 3-O-p-coumarate, Epigallocatechin 3-p-coumarate, (-)-Epigallocatechin 3-p-coumaroic acid, (-)-Epigallocatechin 3-O-P-coumaroate, 3-O-P-Coumaroylepigallocatechin, Epigallocatechin 3-O-P-coumarate, Epigallocatechin 3-O-p-coumaric acid, Epigallocatechin 3-p-coumaric acid |
| Compound Name | Epigallocatechin 3-O-p-coumarate |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 452.111 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 452.111 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 452.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Esol | -4.173909363636365 |
| Inchi | InChI=1S/C24H20O9/c25-14-4-1-12(2-5-14)3-6-22(30)32-21-11-16-17(27)9-15(26)10-20(16)33-24(21)13-7-18(28)23(31)19(29)8-13/h1-10,21,24-29,31H,11H2/b6-3+/t21-,24-/m1/s1 |
| Smiles | C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O |
| Nring | 4.0 |
| Defined Bond Stereocenter Count | 1.0 |
| Taxonomy Direct Parent | Epigallocatechins |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;fooddb_chem_all;npass_chem_all