Archangelicin
PubChem CID: 6450203
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Archangelicin, Archanagelicine, RVGGCRQPGKFZDS-PVRNWPCDSA-N, (Z)-2-((8S,9R)-9-(((Z)-2-Methylbut-2-enoyl)oxy)-2-oxo-8,9-dihydro-2H-furo[2,3-h]chromen-8-yl)propan-2-yl 2-methylbut-2-enoate, 2-(9-{[(2Z)-2-methylbut-2-enoyl]oxy}-2-oxo-2H,8H,9H-furo[2,3-h]chromen-8-yl)propan-2-yl (2Z)-2-methylbut-2-enoate |
|---|---|
| Topological Polar Surface Area | 88.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 31.0 |
| Description | Constituent of the roots of Angelica archangelica (anglica). Archangelicin is found in many foods, some of which are fats and oils, green vegetables, herbs and spices, and angelica. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 835.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | [8-[2-[(Z)-2-methylbut-2-enoyl]oxypropan-2-yl]-2-oxo-8,9-dihydrofuro[2,3-h]chromen-9-yl] (Z)-2-methylbut-2-enoate |
| Nih Violation | False |
| Class | Coumarins and derivatives |
| Xlogp | 4.3 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Furanocoumarins |
| Molecular Formula | C24H26O7 |
| Inchi Key | RVGGCRQPGKFZDS-PVRNWPCDSA-N |
| Rotatable Bond Count | 7.0 |
| State | Solid |
| Synonyms | Archanagelicine, Archangelicin, 2-(9-{[(2Z)-2-methylbut-2-enoyl]oxy}-2-oxo-2H,8H,9H-furo[2,3-H]chromen-8-yl)propan-2-yl (2Z)-2-methylbut-2-enoic acid |
| Compound Name | Archangelicin |
| Kingdom | Organic compounds |
| Exact Mass | 426.168 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 426.168 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 426.5 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 2.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Inchi | InChI=1S/C24H26O7/c1-7-13(3)22(26)30-20-18-16(11-9-15-10-12-17(25)29-19(15)18)28-21(20)24(5,6)31-23(27)14(4)8-2/h7-12,20-21H,1-6H3/b13-7-,14-8- |
| Smiles | C/C=C(/C)\C(=O)OC1C(OC2=C1C3=C(C=C2)C=CC(=O)O3)C(C)(C)OC(=O)/C(=C\C)/C |
| Defined Bond Stereocenter Count | 2.0 |
| Taxonomy Direct Parent | Angular furanocoumarins |
- 1. Outgoing r'ship
FOUND_INto/from Angelica Keiskei (Plant) Rel Props:Source_db:fooddb_chem_all