Sucrose-6-phosphate
PubChem CID: 644101
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | sucrose-6-phosphate, Sucrose 6-phosphate, 6-O-Phosphonosucrose, 22372-29-8, 6-Phosphosucrose, 71N414Q30X, beta-D-Fructofuranosyl-6-O-phosphono-alpha-D-glucopyranoside, sucrose 6(G)-phosphate, beta-D-fructofuranosyl 6-O-phosphono-alpha-D-glucopyranoside, ((2R,3S,4S,5R,6R)-6-(((2S,3S,4S,5R)-3,4-Dihydroxy-2,5-bis(hydroxymethyl)tetrahydrofuran-2-yl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)methyl dihydrogen phosphate, UNII-71N414Q30X, alpha-D-glucopyranosyl-(1<->2)-beta-D-fructofuranoside 6-phosphate, beta-D-fructofuranosyl-(1<->2)-alpha-D-glucopyranoside 6-phosphate, SCHEMBL134508, DTXSID00945023, CHEBI:131603, sucrose 6-phosphate (P on 6-ring), Hex-2-ulofuranosyl 6-O-phosphonohexopyranoside, Q27225216, alpha-D-Glucopyranoside, beta-D-fructofuranosyl-6-(dihydrogen phosphate), alpha-D-glucopyranoside,beta-D-fructofuranosyl-6-(dihydrogen phosphate) |
|---|---|
| Topological Polar Surface Area | 236.0 |
| Hydrogen Bond Donor Count | 9.0 |
| Inchi Key | WQQSIXKPRAUZJL-UGDNZRGBSA-N |
| Rotatable Bond Count | 7.0 |
| Synonyms | 6-O-Phosphonosucrose, 6-Phosphosucrose, Sucrose 6F-phosphate, Sucrose-6-phosphate |
| Heavy Atom Count | 27.0 |
| Compound Name | Sucrose-6-phosphate |
| Description | Sucrose-6-phosphate, also known as 6-O-phosphonosucrose or sucrose 6-phosphoric acid, is a member of the class of compounds known as disaccharide phosphates. Disaccharide phosphates are disaccharides carrying one or more phosphate group on a sugar unit. Sucrose-6-phosphate is soluble (in water) and a moderately acidic compound (based on its pKa). Sucrose-6-phosphate can be found in a number of food items such as opium poppy, oyster mushroom, globe artichoke, and shea tree, which makes sucrose-6-phosphate a potential biomarker for the consumption of these food products. Sucrose-6-phosphate exists in E.coli (prokaryote) and yeast (eukaryote). |
| Exact Mass | 422.083 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 422.083 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 542.0 |
| Hydrogen Bond Acceptor Count | 14.0 |
| Molecular Weight | 422.28 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | [(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl dihydrogen phosphate |
| Total Atom Stereocenter Count | 9.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C12H23O14P/c13-1-4-7(16)10(19)12(3-14,25-4)26-11-9(18)8(17)6(15)5(24-11)2-23-27(20,21)22/h4-11,13-19H,1-3H2,(H2,20,21,22)/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1 |
| Smiles | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COP(=O)(O)O)O)O)O)O)O)O |
| Xlogp | -5.3 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C12H23O14P |
- 1. Outgoing r'ship
FOUND_INto/from Cucumis Sativus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Lycopersicon Esculentum (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all - 7. Outgoing r'ship
FOUND_INto/from Spinacia Oleracea (Plant) Rel Props:Source_db:fooddb_chem_all - 8. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all