28-Deacetylbelamcandal
PubChem CID: 6440311
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 28-Deacetylbelamcandal, 138521-96-7, CCRIS 8443, (2Z)-2-[(3S,4R,5S,6R,10S)-4,10-dihydroxy-3-[(2E,4E)-1-hydroxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl]-6-(3-hydroxypropyl)-10-methylspiro[4.5]decan-7-ylidene]propanal, Propanal, 2-((1R,2S,5S,6R,10S)-1,10-dihydroxy-2-((1E,3E)-1-(hydroxymethyl)-9-methyl-5-methylene-1,3,8-decatrienyl)-6-(3-hydroxypropyl)-10-methylspiro(4.5)dec-7-ylidene)-, (2Z)-, (2Z)-2-((3S,4R,5S,6R,10S)-4,10-dihydroxy-3-((2E,4E)-1-hydroxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl)-6-(3-hydroxypropyl)-10-methylspiro(4.5)decan-7-ylidene)propanal |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 98.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCCC2(CCCC2)C1 |
| Deep Smiles | OCCC[C@@H]/C=CC=O))/C))/CC[C@][C@@]6CC[C@H][C@H]5O))/C=CC=CC=C)CCC=CC)C)))))))))/CO)))))))C)O |
| Heavy Atom Count | 35.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | CC1CCCC2(CCCC2)C1 |
| Classyfire Subclass | Sesterterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 875.0 |
| Database Name | cmaup_ingredients;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Iupac Name | (2Z)-2-[(3S,4R,5S,6R,10S)-4,10-dihydroxy-3-[(2E,4E)-1-hydroxy-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl]-6-(3-hydroxypropyl)-10-methylspiro[4.5]decan-7-ylidene]propanal |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 4.2 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H46O5 |
| Scaffold Graph Node Bond Level | C=C1CCCC2(CCCC2)C1 |
| Prediction Swissadme | 0.0 |
| Inchi Key | XVFORSWJIMCHND-ADWNQYOQSA-N |
| Silicos It Class | Poorly soluble |
| Fcsp3 | 0.6333333333333333 |
| Logs | -4.213 |
| Rotatable Bond Count | 11.0 |
| Logd | 3.009 |
| Synonyms | 28-deacetyl-belamcandal, 28-deacetylbelamcandal |
| Esol Class | Poorly soluble |
| Functional Groups | C/C(C)=C(C)C=O, C=C(C)/C=C/C=C(/C)C, CC=C(C)C, CO |
| Compound Name | 28-Deacetylbelamcandal |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 486.335 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 486.335 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 486.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 3.0 |
| Lipinski Rule Of 5 | True |
| Esol | -4.808996600000002 |
| Inchi | InChI=1S/C30H46O5/c1-21(2)9-6-10-22(3)11-7-12-24(20-33)26-15-17-30(28(26)34)27(13-8-18-31)25(23(4)19-32)14-16-29(30,5)35/h7,9,11-12,19,26-28,31,33-35H,3,6,8,10,13-18,20H2,1-2,4-5H3/b11-7+,24-12-,25-23-/t26-,27+,28+,29-,30-/m0/s1 |
| Smiles | CC(=CCCC(=C)/C=C/C=C(/CO)\[C@@H]1CC[C@@]2([C@@H]1O)[C@@H](/C(=C(/C)\C=O)/CC[C@]2(C)O)CCCO)C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 3.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Curcuma Domestica (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Iris Bungei (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Iris Cristata (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Iris Decora (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Iris Dichotoma (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Iris Domestica (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Iris Ensata (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Iris Florentina (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Iris Germanica (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Iris Halophila (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Iris Hoogiana (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Iris Hookeriana (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Iris Japonica (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Iris Kashmiriana (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Iris Kemaonensis (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Iris Lactea (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Iris Milesii (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Iris Nepalensis (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Iris Pallasii (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Iris Pallida (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Iris Potaninii (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Iris Pseudacorus (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Iris Sanguinea (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Iris Sibirica (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Iris Spuria (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Iris Tectorum (Plant) Rel Props:Reference: - 27. Outgoing r'ship
FOUND_INto/from Iris Tingitana (Plant) Rel Props:Reference: - 28. Outgoing r'ship
FOUND_INto/from Iris Unguicularis (Plant) Rel Props:Reference: - 29. Outgoing r'ship
FOUND_INto/from Iris Versicolor (Plant) Rel Props:Reference: - 30. Outgoing r'ship
FOUND_INto/from Malus Domestica (Plant) Rel Props:Reference: - 31. Outgoing r'ship
FOUND_INto/from Mangifera Domestica (Plant) Rel Props:Reference: - 32. Outgoing r'ship
FOUND_INto/from Nandina Domestica (Plant) Rel Props:Reference: - 33. Outgoing r'ship
FOUND_INto/from Prunus Domestica (Plant) Rel Props:Reference: - 34. Outgoing r'ship
FOUND_INto/from Sorbus Domestica (Plant) Rel Props:Reference: