(13Z)-Lycopene
PubChem CID: 6440310
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 13-cis-Lycopene, (13Z)-Lycopene, 13018-46-7, 13-cis-psi,psi-Carotene, VTJ88XVZ9N, psi,psi-Carotene, 13-cis-, NEOLYCOPENE A, NEO-A LYCOPENE, UNII-VTJ88XVZ9N, 13'-CIS-LYCOPENE, CHEBI:177907, DTXSID90920485, (6E,8E,10E,12E,14E,16E,18Z,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene, .PSI.,.PSI.-CAROTENE, 13-CIS-, (13cis)-psi,psi-carotene, DTXCID501349393 |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 40.0 |
| Description | (13z)-lycopene is a member of the class of compounds known as carotenes. Carotenes are a type of unsaturated hydrocarbons containing eight consecutive isoprene units. They are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family (13z)-lycopene can be found in guava, which makes (13z)-lycopene a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1050.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (6E,8E,10E,12E,14E,16E,18Z,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene |
| Nih Violation | True |
| Class | Prenol lipids |
| Xlogp | 15.6 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Tetraterpenoids |
| Molecular Formula | C40H56 |
| Inchi Key | OAIJSZIZWZSQBC-FZXCKFLSSA-N |
| Rotatable Bond Count | 16.0 |
| Synonyms | 13-cis-psi,psi-Carotene, psi,psi-Carotene, 13-cis- |
| Compound Name | (13Z)-Lycopene |
| Kingdom | Organic compounds |
| Exact Mass | 536.438 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 536.438 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 536.9 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 11.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21-,36-22+,37-27+,38-28+,39-29+,40-30+ |
| Smiles | CC(=CCC/C(=C/C=C/C(=C/C=C/C(=C/C=C/C=C(/C)\C=C\C=C(/C)\C=C\C=C(/C)\CCC=C(C)C)/C)/C)/C)C |
| Defined Bond Stereocenter Count | 11.0 |
| Taxonomy Direct Parent | Carotenes |
- 1. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Source_db:fooddb_chem_all