Perflutren
PubChem CID: 6432
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Perfluoropropane, Perflutren, OCTAFLUOROPROPANE, 76-19-7, Definity, Propane, octafluoro-, 1,1,1,2,2,3,3,3-Octafluoropropane, Freon 218, luminity, Oktafluorpropan, Optison, Genetron 218, Octafluorpropan, MRX-115, FC 218 (refrigerant), FC 218, DMP 115, C3F8-gas, HFC 218, PFC 218, FS069, Perflutren Lipid Microsphere, perflutrene, Perflutreno, UN 2424, DMP-115, UNII-CK0N3WH0SR, CK0N3WH0SR, octafluoro-propane, R 218, EINECS 200-941-9, CHEBI:31980, HSDB 8074, Propane,1,1,1,2,2,3,3,3-octafluoro-, FS-069, DTXSID9052503, EC 200-941-9, Perflutren [USAN], PERFLUTREN (II), PERFLUTREN [II], Propane, 1,1,1,2,2,3,3,3-octafluoro-, PERFLUTREN (MART.), PERFLUTREN [MART.], Albumin human, MFCD00039239, UN2424, perflutrenum, Perflutren lipid microspheres, Perflutren [USAN:INN:BAN], C3F8, Definity (TN), Optison (Salt/Mix), DEFINITY RT, OXTAFLUOROPROPANE, R218, PERFLUTREN [INN], PERFLUTREN [JAN], PERFLUTREN [VANDF], Perflutren-lipid microsphere, Perflutren Protein-Type A Microspheres injection, CHEMBL1663, PERFLUTREN [WHO-DD], PERFLUOROPROPANE [MI], Octafluoropropane, high purity, Perflutren (JAN/USAN/INN), PERFLUTREN [EMA EPAR], DMP115, REFRIGERANT GAS R-218, DTXCID3031076, PERFLUTREN [ORANGE BOOK], OCTAFLUOROPROPANE [VANDF], OXTAFLUOROPROPANE [VANDF], MRX 115, octafluoropropane-lipid microsphere, YM454, Dulbecco's phosphate buffered saline, AKOS006228213, DB00556, FD45394, FS-6566, Octafluoropropaneor Refrigerant gas R 218, DB-056033, NS00006776, 1,1,1,2,2,3,3,3-octakis(fluoranyl)propane, D01738, A838638, Q412659, Octafluoropropaneor Refrigerant gas R 218 [UN2424] [Nonflammable gas], 200-941-9 |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 11.0 |
| Description | Perflutren, a diagnostic drug that is intended to be used for contrast enhancement during the indicated echocardiographic procedures, comprised of lipid-coated microspheres filled with octafluoropropane(OFP) gas. It provide contrast enhancement of the endocardial borders during echocardiography. The perflutren lipid microspheres exhibit lower acoustic impedance than blood and enhance the intrinsic backscatter of blood. Albumin is found in brazil nut, common wheat, and ginger. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 120.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,1,1,2,2,3,3,3-octafluoropropane |
| Nih Violation | False |
| Class | Organofluorides |
| Xlogp | 3.1 |
| Superclass | Organohalogen compounds |
| Is Pains | False |
| Molecular Formula | C3F8 |
| Inchi Key | QYSGYZVSCZSLHT-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| State | Liquid |
| Synonyms | 1,1,1,2,2,3,3,3-octafluoropropane, Albumin human, Albumin, human, Albuminar-20, Albuminar-25, Albuminar-5, Albumins, human, Alburx, Albutein 25% Soln Usp, Albutein 5% Soln Usp, Buminate 25%, Buminate 5%, C3F8-gas, Definity, Definity (TN), Diluent for allergenic extract sterile albumin saline with phenol, FC 218, FC 218 (refrigerant), Flexbumin, Freon 218, Genetron 218, Human albumin, Human albumin - perflutren, Jeanatope, Liposome-encapsulated perfluoropane microsphere, Octafluoropropane, Octafluoropropane-lipid microsphere, Octafluorpropan, Oktafluorpropan, Optison, Perfluoropropane, Perfluoropropane - albumin, Perflutren, Perflutren - human albumin, Perflutren (jan/usan/inn), Perflutren [usan], Perflutren and human albumin, Perflutren lipid microsphere, Perflutren-lipid microsphere, Propane, 1,1,1,2,2,3,3,3-octafluoro-, Propane, octafluoro- |
| Substituent Name | Hydrocarbon derivative, Organofluoride, Alkyl halide, Alkyl fluoride, Aliphatic acyclic compound |
| Compound Name | Perflutren |
| Kingdom | Organic compounds |
| Exact Mass | 187.987 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 187.987 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 188.02 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C3F8/c4-1(5,2(6,7)8)3(9,10)11 |
| Smiles | C(C(F)(F)F)(C(F)(F)F)(F)F |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:fooddb_chem_all