Perflutren
PubChem CID: 6432
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Perfluoropropane, Perflutren, OCTAFLUOROPROPANE, 76-19-7, Definity, Propane, octafluoro-, 1,1,1,2,2,3,3,3-Octafluoropropane, Freon 218, luminity, Oktafluorpropan, Optison, Genetron 218, Octafluorpropan, MRX-115, FC 218 (refrigerant), FC 218, DMP 115, C3F8-gas, HFC 218, PFC 218, FS069, Perflutren Lipid Microsphere, perflutrene, Perflutreno, UN 2424, DMP-115, UNII-CK0N3WH0SR, CK0N3WH0SR, octafluoro-propane, R 218, EINECS 200-941-9, CHEBI:31980, HSDB 8074, Propane,1,1,1,2,2,3,3,3-octafluoro-, FS-069, DTXSID9052503, EC 200-941-9, Perflutren [USAN], PERFLUTREN (II), PERFLUTREN [II], Propane, 1,1,1,2,2,3,3,3-octafluoro-, PERFLUTREN (MART.), PERFLUTREN [MART.], Albumin human, MFCD00039239, UN2424, perflutrenum, Perflutren lipid microspheres, Perflutren [USAN:INN:BAN], C3F8, Definity (TN), Optison (Salt/Mix), DEFINITY RT, OXTAFLUOROPROPANE, R218, PERFLUTREN [INN], PERFLUTREN [JAN], PERFLUTREN [VANDF], Perflutren-lipid microsphere, Perflutren Protein-Type A Microspheres injection, CHEMBL1663, PERFLUTREN [WHO-DD], PERFLUOROPROPANE [MI], Octafluoropropane, high purity, Perflutren (JAN/USAN/INN), PERFLUTREN [EMA EPAR], DMP115, REFRIGERANT GAS R-218, DTXCID3031076, PERFLUTREN [ORANGE BOOK], OCTAFLUOROPROPANE [VANDF], OXTAFLUOROPROPANE [VANDF], MRX 115, octafluoropropane-lipid microsphere, YM454, Dulbecco's phosphate buffered saline, AKOS006228213, DB00556, FD45394, FS-6566, Octafluoropropaneor Refrigerant gas R 218, DB-056033, NS00006776, 1,1,1,2,2,3,3,3-octakis(fluoranyl)propane, D01738, A838638, Q412659, Octafluoropropaneor Refrigerant gas R 218 [UN2424] [Nonflammable gas], 200-941-9 |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | QYSGYZVSCZSLHT-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| State | Liquid |
| Substituent Name | Hydrocarbon derivative, Organofluoride, Alkyl halide, Alkyl fluoride, Aliphatic acyclic compound |
| Synonyms | 1,1,1,2,2,3,3,3-octafluoropropane, Albumin human, Albumin, human, Albuminar-20, Albuminar-25, Albuminar-5, Albumins, human, Alburx, Albutein 25% Soln Usp, Albutein 5% Soln Usp, Buminate 25%, Buminate 5%, C3F8-gas, Definity, Definity (TN), Diluent for allergenic extract sterile albumin saline with phenol, FC 218, FC 218 (refrigerant), Flexbumin, Freon 218, Genetron 218, Human albumin, Human albumin - perflutren, Jeanatope, Liposome-encapsulated perfluoropane microsphere, Octafluoropropane, Octafluoropropane-lipid microsphere, Octafluorpropan, Oktafluorpropan, Optison, Perfluoropropane, Perfluoropropane - albumin, Perflutren, Perflutren - human albumin, Perflutren (jan/usan/inn), Perflutren [usan], Perflutren and human albumin, Perflutren lipid microsphere, Perflutren-lipid microsphere, Propane, 1,1,1,2,2,3,3,3-octafluoro-, Propane, octafluoro- |
| Heavy Atom Count | 11.0 |
| Compound Name | Perflutren |
| Kingdom | Organic compounds |
| Description | Perflutren, a diagnostic drug that is intended to be used for contrast enhancement during the indicated echocardiographic procedures, comprised of lipid-coated microspheres filled with octafluoropropane(OFP) gas. It provide contrast enhancement of the endocardial borders during echocardiography. The perflutren lipid microspheres exhibit lower acoustic impedance than blood and enhance the intrinsic backscatter of blood. Albumin is found in brazil nut, common wheat, and ginger. |
| Exact Mass | 187.987 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 187.987 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 120.0 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 188.02 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,1,1,2,2,3,3,3-octafluoropropane |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Class | Organofluorides |
| Inchi | InChI=1S/C3F8/c4-1(5,2(6,7)8)3(9,10)11 |
| Smiles | C(C(F)(F)F)(C(F)(F)F)(F)F |
| Xlogp | 3.1 |
| Superclass | Organohalogen compounds |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C3F8 |
- 1. Outgoing r'ship
FOUND_INto/from Triticum Aestivum (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Zingiber Officinale (Plant) Rel Props:Source_db:fooddb_chem_all