Mesaconic acid
PubChem CID: 638129
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | mesaconic acid, 498-24-8, 2-Methylfumaric acid, Methylfumaric acid, mesaconate, 2-Butenedioic acid, 2-methyl-, (2E)-, Fumaric acid, methyl-, trans-2-Methyl-2-butenedioic acid, trans-1-Propene-1,2-dicarboxylic acid, Kyselina mesakonova, (2E)-2-METHYLBUT-2-ENEDIOIC ACID, Citronic acid, (E)-2-methylbut-2-enedioic acid, Butenedioic acid, methyl-, (E)-, 2-Butenedioic acid, 2-methyl-, (E)-, 2-methylfumarate, Kyselina mesakonova [Czech], 2-methylbut-2-enedioic acid, (E)-Citraconic acid, NSC 65438, (E)-2-Methyl-2-butenedioic acid, (2E)-2-Methyl-2-butenedioic acid, EINECS 207-859-2, 2-methyl-2E-butenedioic acid, BRN 1722680, NSC-65438, MESACONIC ACID [MI], 90UTM639KK, CHEBI:16600, DTXSID10883407, methylfumarate, 4-02-00-02231 (Beilstein Handbook Reference), NSC32949, MFCD00002653, 7407-59-2, UNII-90UTM639KK, Citronate, (E)-Citraconate, Mesaconic acid, 99%, bmse000746, WLN: QVY1&U1VQ, SCHEMBL5894, SCHEMBL28517, trans-2-Methyl-2-butenedioate, WLN: QVY1&U1VQ -T, (2E)-2-Methyl-2-butenedioate, MESACONIC ACID, MESACONATE, DTXCID101022939, NSC65438, trans-1-Propene-1,2-dicarboxylate, (E)-2-methyl-but-2-enedioic acid, BBL023435, LMFA01170116, STL299679, AKOS000119631, (2E)-2-Methyl-2-butenedioic acid #, FM168005, HY-78036, CS-0007669, CS-0368860, M0066, NS00015255, EN300-19991, 2-Butenedioic acid, 2-methyl-, (E)-(9CI), C01732, G77236, 2-Butenedioic acid, 2-methyl-, (E)- (9CI), EN300-1387340, Q3544981, Z104476308, FB1827E3-2A34-43A5-BDDC-481FC6606513, 207-859-2 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 74.6 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Dicarboxylic acids |
| Deep Smiles | OC=O)/C=C/C=O)O))C |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Fatty acyls |
| Description | Mesaconic acid is one of several isomeric carboxylic acids obtained from citric acid. Is used as a fire retardant, recent studies revealed this acid is a competitive inhibitor of fumarate reduction. [HMDB] |
| Classyfire Subclass | Fatty acids and conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 168.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (E)-2-methylbut-2-enedioic acid |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Fatty Acyls |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | -0.1 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty acids and conjugates |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H6O4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | HNEGQIOMVPPMNR-NSCUHMNNSA-N |
| Silicos It Class | Soluble |
| Fcsp3 | 0.2 |
| Logs | 0.038 |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Logd | 2.65 |
| Synonyms | (Z)-2-Methyl-2-butenedioate, (Z)-2-Methyl-2-butenedioic acid, 2-Methyl-2-butenedioate, 2-Methyl-2-butenedioic acid, 2-Methylmaleate, 2-Methylmaleic acid, a-Methylmaleate, a-Methylmaleic acid, alpha-Methylmaleate, alpha-Methylmaleic acid, cis-2-Methylbutenedioate, cis-2-Methylbutenedioic acid, cis-Methylbutenedioate, cis-Methylbutenedioic acid, Citraconate, Citraconic acid, Citraconsaeure, Methyl-maleinsaeure, Methylmaleate, Methylmaleic acid, α-methylmaleate, α-methylmaleic acid, (2E)-2-Methyl-2-butenedioate, (2E)-2-Methyl-2-butenedioic acid, (e)-2-Methyl-2-butenedioate, (e)-2-Methyl-2-butenedioic acid, (E)-Citraconate, (E)-Citraconic acid, 2-Methylfumarate, 2-Methylfumaric acid, Citronate, Citronic acid, Mesaconate, Methylfumarate, Methylfumaric acid, trans-1-Propene-1,2-dicarboxylate, trans-1-Propene-1,2-dicarboxylic acid, trans-2-Methyl-2-butenedioate, trans-2-Methyl-2-butenedioic acid, (e)-Citraconic acid, (e)-Citraconate, Citraconic acid, (e)-isomer, Citraconic acid, ammonium salt, Citraconic acid, calcium salt, Citraconic acid, sodium salt, Monomethylfumarate, mesaconic acid |
| Substituent Name | Methyl-branched fatty acid, Unsaturated fatty acid, Dicarboxylic acid or derivatives, Carboxylic acid, Carboxylic acid derivative, Hydrocarbon derivative, Organooxygen compound, Carbonyl group, Aliphatic acyclic compound |
| Esol Class | Very soluble |
| Functional Groups | C/C(=CC(=O)O)C(=O)O |
| Compound Name | Mesaconic acid |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 130.027 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 130.027 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 130.1 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -0.47051379999999987 |
| Inchi | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h2H,1H3,(H,6,7)(H,8,9)/b3-2+ |
| Smiles | C/C(=C\C(=O)O)/C(=O)O |
| Nring | 0.0 |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Methyl-branched fatty acids |
| Np Classifier Superclass | Fatty Acids and Conjugates |
- 1. Outgoing r'ship
FOUND_INto/from Saccharum Officinarum (Plant) Rel Props:Reference:ISBN:9788172362140 - 2. Outgoing r'ship
FOUND_INto/from Saccharum Sinensis (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all